![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | Ace Attorney/ | 2024-04-06 17:18 | - | |
![[SND]](/icons/sound2.gif) | [ut] power of neo.opus | 2023-10-15 06:45 | 112K | |
![[SND]](/icons/sound2.gif) | [dr] rouxls kaard.opus | 2021-05-01 19:28 | 227K | |
![[SND]](/icons/sound2.gif) | [Sky] espanol.opus | 2024-09-22 12:02 | 228K | |
![[SND]](/icons/sound2.gif) | [p5] suspicious person.opus | 2021-05-02 21:18 | 273K | |
![[SND]](/icons/sound2.gif) | [ut] tem shop.opus | 2023-10-12 09:44 | 278K | |
![[SND]](/icons/sound2.gif) | [ut] shop.opus | 2023-10-12 09:44 | 280K | |
![[SND]](/icons/sound2.gif) | [ut] ghost fight.opus | 2023-01-27 21:20 | 303K | |
![[SND]](/icons/sound2.gif) | [dgs] the final tragedy.opus | 2020-11-25 20:07 | 308K | |
![[SND]](/icons/sound2.gif) | [dgs] burst of flames.opus | 2020-11-25 20:07 | 325K | |
![[SND]](/icons/sound2.gif) | [ut] your best friend.opus | 2021-05-03 12:47 | 326K | |
![[SND]](/icons/sound2.gif) | [p4] welcome to the limousine.opus | 2021-05-02 19:52 | 333K | |
![[SND]](/icons/sound2.gif) | [dgs] the great detective's melancholy.opus | 2020-11-25 20:07 | 347K | |
![[SND]](/icons/sound2.gif) | [dgs2] connette rozaic - mysteries pressed in wax.opus | 2020-11-25 20:07 | 352K | |
![[SND]](/icons/sound2.gif) | [dgs] the adventure of the great departure.opus | 2020-11-25 20:07 | 356K | |
![[SND]](/icons/sound2.gif) | [dgs2] clockwork people.opus | 2020-11-25 20:07 | 359K | |
![[SND]](/icons/sound2.gif) | [dr] susie.opus | 2021-05-01 19:28 | 366K | |
![[SND]](/icons/sound2.gif) | [p5] gochitera gang.opus | 2021-05-02 21:17 | 371K | |
![[SND]](/icons/sound2.gif) | [ut] spooktune.opus | 2021-05-03 12:47 | 392K | |
![[SND]](/icons/sound2.gif) | [p5] planetarium.opus | 2021-05-02 21:18 | 398K | |
![[SND]](/icons/sound2.gif) | [omori] the vengeance of those forgotten in darkness.opus | 2023-01-27 21:19 | 406K | |
![[SND]](/icons/sound2.gif) | [dgs2] a prelude to my partner.opus | 2020-11-25 20:07 | 417K | |
![[SND]](/icons/sound2.gif) | [ut] dogsong.opus | 2021-05-03 12:46 | 423K | |
![[SND]](/icons/sound2.gif) | [HDusk] The City Sleeps ~ HD.opus | 2023-07-03 00:21 | 435K | |
![[SND]](/icons/sound2.gif) | [dr] vs. lancer.opus | 2021-05-01 19:28 | 439K | |
![[SND]](/icons/sound2.gif) | [dgs] omen.opus | 2020-11-25 20:07 | 442K | |
![[SND]](/icons/sound2.gif) | [dgs] music box - the great detective of the foggy town.opus | 2020-11-25 20:07 | 449K | |
![[SND]](/icons/sound2.gif) | [p5] trick.opus | 2021-05-02 21:19 | 454K | |
![[SND]](/icons/sound2.gif) | [p5] star forneus.opus | 2021-05-02 21:18 | 475K | |
![[SND]](/icons/sound2.gif) | [va-11 hall-a] final result.opus | 2021-10-04 05:49 | 485K | |
![[SND]](/icons/sound2.gif) | [dgs] music box - the beginning tone.opus | 2020-11-25 20:07 | 495K | |
![[SND]](/icons/sound2.gif) | [p5] everyday days.opus | 2021-05-02 21:17 | 504K | |
![[SND]](/icons/sound2.gif) | [aa] prologue.opus | 2021-05-21 07:35 | 516K | |
![[SND]](/icons/sound2.gif) | [dgs] dawn of the unspeakable story.opus | 2020-11-25 20:07 | 521K | |
![[SND]](/icons/sound2.gif) | [aaaj] suspense.opus | 2021-05-07 07:38 | 525K | |
![[SND]](/icons/sound2.gif) | [dr] hip shop.opus | 2021-05-01 19:28 | 536K | |
![[SND]](/icons/sound2.gif) | [p5] encounter.opus | 2021-05-02 21:17 | 541K | |
![[SND]](/icons/sound2.gif) | [p5] destiny land.opus | 2021-05-02 21:17 | 552K | |
![[SND]](/icons/sound2.gif) | [p5] fall of anger.opus | 2021-05-02 21:17 | 554K | |
![[SND]](/icons/sound2.gif) | [p5] akataro railway.opus | 2021-05-02 21:16 | 554K | |
![[SND]](/icons/sound2.gif) | [dgs2] a farewell - his last bow.opus | 2020-11-25 20:07 | 556K | |
![[SND]](/icons/sound2.gif) | [dgs] joint reasoning (type a-2).opus | 2020-11-25 20:07 | 557K | |
![[SND]](/icons/sound2.gif) | [p4] reasoning -another version-.opus | 2021-05-02 19:52 | 560K | |
![[SND]](/icons/sound2.gif) | [p5] betrayer.opus | 2021-05-02 21:16 | 567K | |
![[SND]](/icons/sound2.gif) | [dgs] elegant people.opus | 2020-11-25 20:07 | 574K | |
![[SND]](/icons/sound2.gif) | [p5] crane game.opus | 2021-05-02 21:17 | 575K | |
![[SND]](/icons/sound2.gif) | [aajfa] hotline of fate.opus | 2021-05-07 12:50 | 578K | |
![[SND]](/icons/sound2.gif) | [p5] escape -another version-.opus | 2021-05-02 21:17 | 588K | |
![[SND]](/icons/sound2.gif) | [dr] lancer.opus | 2021-05-01 19:28 | 588K | |
![[SND]](/icons/sound2.gif) | [p5] big bang burger's march.opus | 2021-05-02 21:16 | 589K | |
![[SND]](/icons/sound2.gif) | [aa] cross-examination ~ moderato (15th).opus | 2021-05-07 13:48 | 594K | |
![[SND]](/icons/sound2.gif) | [dgs] lively people.opus | 2020-11-25 20:07 | 594K | |
![[SND]](/icons/sound2.gif) | [omori] tee-hee time.opus | 2023-01-27 21:19 | 594K | |
![[SND]](/icons/sound2.gif) | [p5] escape.opus | 2021-05-02 21:17 | 598K | |
![[SND]](/icons/sound2.gif) | [p5] collapse of lust.opus | 2021-05-02 21:17 | 600K | |
![[SND]](/icons/sound2.gif) | [p5] hatred goemon.opus | 2021-05-02 21:17 | 603K | |
![[SND]](/icons/sound2.gif) | [dgs] iris watson - bubbly biographer.opus | 2020-11-25 20:07 | 606K | |
![[SND]](/icons/sound2.gif) | [p5] professional golfer monkey tabiko.opus | 2021-05-02 21:18 | 610K | |
![[SND]](/icons/sound2.gif) | [p5] triple seven.opus | 2021-05-02 21:19 | 611K | |
![[SND]](/icons/sound2.gif) | [p5] bar yuu comer.opus | 2021-05-02 21:16 | 616K | |
![[SND]](/icons/sound2.gif) | [dgs] objection!.opus | 2020-11-25 20:07 | 618K | |
![[SND]](/icons/sound2.gif) | [ut] sans.opus | 2021-05-03 12:47 | 622K | |
![[SND]](/icons/sound2.gif) | [p5] dark net.opus | 2021-05-02 21:17 | 623K | |
![[SND]](/icons/sound2.gif) | [va-11 hall-a] digital drive.opus | 2021-10-04 05:49 | 629K | |
![[SND]](/icons/sound2.gif) | [dgs2] the thoughts of ryunosuke naruhodo.opus | 2020-11-25 20:07 | 630K | |
![[SND]](/icons/sound2.gif) | [dgs] prelude to the adventure.opus | 2020-11-25 20:07 | 634K | |
![[SND]](/icons/sound2.gif) | [p4] it's show time!.opus | 2021-05-02 19:51 | 640K | |
![[SND]](/icons/sound2.gif) | [p5] talk.opus | 2021-05-02 21:19 | 642K | |
![[SND]](/icons/sound2.gif) | [ut] bonetrousle.opus | 2021-05-03 12:46 | 651K | |
![[SND]](/icons/sound2.gif) | [dr] now's your chance to be a.opus | 2021-12-09 17:56 | 652K | |
![[SND]](/icons/sound2.gif) | [dgs] joint reasoning (type c).opus | 2020-11-25 20:07 | 653K | |
![[SND]](/icons/sound2.gif) | [dr] my castle town.opus | 2022-10-28 17:29 | 658K | |
![[SND]](/icons/sound2.gif) | [p4] period.opus | 2021-05-02 19:52 | 664K | |
![[SND]](/icons/sound2.gif) | [dgs] joint reasoning (type a).opus | 2020-11-25 20:07 | 664K | |
![[SND]](/icons/sound2.gif) | [ut] song that might play when you fight sans.opus | 2021-05-03 12:47 | 669K | |
![[SND]](/icons/sound2.gif) | [p5] confrontation.opus | 2021-05-02 21:17 | 674K | |
![[SND]](/icons/sound2.gif) | [dgs] joint reasoning (type b).opus | 2020-11-25 20:07 | 677K | |
![[SND]](/icons/sound2.gif) | [aaaj] confess the truth.opus | 2021-05-07 07:36 | 680K | |
![[SND]](/icons/sound2.gif) | [ut] metal crusher.opus | 2021-05-03 12:47 | 701K | |
![[SND]](/icons/sound2.gif) | [dgs2] enoch drebber - the link between science and magic.opus | 2020-11-25 20:07 | 706K | |
![[SND]](/icons/sound2.gif) | [p4] omen.opus | 2021-05-02 19:52 | 710K | |
![[SND]](/icons/sound2.gif) | [dgs] gina lestrade - gunshot from downtown.opus | 2020-11-25 20:07 | 714K | |
![[SND]](/icons/sound2.gif) | [dgs] an ashen dance.opus | 2020-11-25 20:07 | 720K | |
![[SND]](/icons/sound2.gif) | [p5] unfamiliar arrogance.opus | 2021-05-02 21:19 | 720K | |
![[SND]](/icons/sound2.gif) | [ut] enemy approaching.opus | 2022-06-15 12:10 | 721K | |
![[SND]](/icons/sound2.gif) | [va-11 hall-a] jc elton's.opus | 2021-10-04 05:49 | 721K | |
![[SND]](/icons/sound2.gif) | [va-11 hall-a] go! go! streaming-chan!.opus | 2022-02-26 01:09 | 734K | |
![[SND]](/icons/sound2.gif) | [p5] punch de ouch.opus | 2021-05-02 21:18 | 735K | |
![[SND]](/icons/sound2.gif) | [spm] mr. l, green thunder.opus | 2024-03-14 07:01 | 740K | |
![[SND]](/icons/sound2.gif) | [p5] hawaii.opus | 2021-05-02 21:17 | 745K | |
![[SND]](/icons/sound2.gif) | [dgs2] prelude to the blossoming attorney.opus | 2020-11-25 20:07 | 747K | |
![[SND]](/icons/sound2.gif) | [dgs] seafaring people.opus | 2020-11-25 20:07 | 748K | |
![[SND]](/icons/sound2.gif) | [dgs] joint reasoning (type b-2).opus | 2020-11-25 20:07 | 752K | |
![[SND]](/icons/sound2.gif) | [p5] erosion.opus | 2021-05-02 21:17 | 755K | |
![[SND]](/icons/sound2.gif) | [dr] it's pronounced ~rules~.opus | 2021-12-12 07:28 | 756K | |
![[SND]](/icons/sound2.gif) | [p5] memories of a summer day.opus | 2021-05-02 21:18 | 761K | |
![[SND]](/icons/sound2.gif) | [spm] count bleck's plan.opus | 2024-03-14 07:01 | 764K | |
![[SND]](/icons/sound2.gif) | [dgs] london - business as usual.opus | 2020-11-25 20:07 | 765K | |
![[SND]](/icons/sound2.gif) | [dgs2] prelude to resolve.opus | 2020-11-25 20:07 | 765K | |
![[SND]](/icons/sound2.gif) | [dgs2] the great exhibition.opus | 2020-11-25 20:07 | 771K | |
![[SND]](/icons/sound2.gif) | [dgs] prelude.opus | 2020-11-25 20:07 | 771K | |
![[SND]](/icons/sound2.gif) | [ut] temmie village.opus | 2021-05-03 12:47 | 771K | |
![[SND]](/icons/sound2.gif) | [dgs2] objection! (ryutaro).opus | 2020-11-25 20:07 | 774K | |
![[SND]](/icons/sound2.gif) | [aaaj] investigation ~ core.opus | 2021-05-07 07:37 | 775K | |
![[SND]](/icons/sound2.gif) | [p4] quelorie magic!.opus | 2021-05-02 19:52 | 776K | |
![[SND]](/icons/sound2.gif) | [dgs] russian people.opus | 2020-11-25 20:07 | 777K | |
![[SND]](/icons/sound2.gif) | [dgs2] prelude.opus | 2020-11-25 20:07 | 785K | |
![[SND]](/icons/sound2.gif) | [dgs2] pursuit (overture).opus | 2020-11-25 20:07 | 791K | |
![[SND]](/icons/sound2.gif) | [p5] confession-secret -piano version-.opus | 2021-05-02 21:17 | 792K | |
![[SND]](/icons/sound2.gif) | [dgs2] the prison guards.opus | 2020-11-25 20:07 | 797K | |
![[SND]](/icons/sound2.gif) | [p5] welcome back! master♡.opus | 2021-05-02 21:19 | 799K | |
![[SND]](/icons/sound2.gif) | [dgs] questioning (moderato).opus | 2020-11-25 20:07 | 801K | |
![[SND]](/icons/sound2.gif) | [gt] fate changed ~ variation.opus | 2021-05-02 09:48 | 803K | |
![[SND]](/icons/sound2.gif) | [dgs] robert crogley - unhand me, filthy urchin!.opus | 2020-11-25 20:07 | 804K | |
![[SND]](/icons/sound2.gif) | [ut] can you really call this a hotel i didn't receive a mint on my pillow or anything.opus | 2021-05-03 12:46 | 808K | |
![[SND]](/icons/sound2.gif) | [dgs] natsume souseki - i am innocent.opus | 2020-11-25 20:07 | 810K | |
![[SND]](/icons/sound2.gif) | [dgs2] bitter memories.opus | 2020-11-25 20:07 | 817K | |
![[SND]](/icons/sound2.gif) | [dr] queen.opus | 2021-12-09 17:56 | 822K | |
![[SND]](/icons/sound2.gif) | [dgs] suspense.opus | 2020-11-25 20:07 | 826K | |
![[SND]](/icons/sound2.gif) | [p5] penalty time.opus | 2021-05-02 21:18 | 831K | |
![[SND]](/icons/sound2.gif) | [ut] fallen down.opus | 2022-06-15 12:15 | 832K | |
![[SND]](/icons/sound2.gif) | [dgs] witnesses enter the court.opus | 2020-11-25 20:08 | 832K | |
![[SND]](/icons/sound2.gif) | [p5] recall ~ hint.opus | 2021-05-02 21:18 | 840K | |
![[SND]](/icons/sound2.gif) | [dgs] deduction - beyond logic.opus | 2020-11-25 20:07 | 842K | |
![[SND]](/icons/sound2.gif) | [dgs] hart vortex - the passing of time.opus | 2020-11-25 20:07 | 848K | |
![[SND]](/icons/sound2.gif) | [dgs] mikotoba susato - moment of truth.opus | 2020-11-25 20:07 | 859K | |
![[SND]](/icons/sound2.gif) | [p5] victory.opus | 2021-05-02 21:19 | 864K | |
![[SND]](/icons/sound2.gif) | [dgs2] the wax museum.opus | 2020-11-25 20:07 | 866K | |
![[SND]](/icons/sound2.gif) | [gt] fate changed.opus | 2021-05-02 09:49 | 868K | |
![[SND]](/icons/sound2.gif) | [dgs] asougi kazuma - samurai with a mission.opus | 2020-11-25 20:07 | 869K | |
![[SND]](/icons/sound2.gif) | [dgs] 221b bakers street.opus | 2020-11-25 20:07 | 873K | |
![[SND]](/icons/sound2.gif) | [dr] rude buster.opus | 2021-05-01 19:28 | 873K | |
![[SND]](/icons/sound2.gif) | [dgs] victory!.opus | 2020-11-25 20:08 | 875K | |
![[SND]](/icons/sound2.gif) | [dgs] reasoning battle (allegro).opus | 2020-11-25 20:07 | 876K | |
![[SND]](/icons/sound2.gif) | [p5] to another world.opus | 2021-05-02 21:19 | 877K | |
![[SND]](/icons/sound2.gif) | [dgs] reasoning battle.opus | 2020-11-25 20:07 | 883K | |
![[SND]](/icons/sound2.gif) | [omori] duet.opus | 2023-01-27 21:19 | 888K | |
![[SND]](/icons/sound2.gif) | [dgs] the thoughts of sherlock holmes.opus | 2020-11-25 20:08 | 889K | |
![[SND]](/icons/sound2.gif) | [dgs2] the great detective's friendship.opus | 2020-11-25 20:07 | 895K | |
![[SND]](/icons/sound2.gif) | [dgs] logic and trick.opus | 2020-11-25 20:07 | 895K | |
![[SND]](/icons/sound2.gif) | [dgs] tobias gregson - the enemy of great detective.opus | 2020-11-25 20:08 | 898K | |
![[SND]](/icons/sound2.gif) | [hk] resting grounds.opus | 2021-08-30 21:00 | 900K | |
![[SND]](/icons/sound2.gif) | [dgs] gina lestrade - the messenger from the slums.opus | 2020-11-25 20:07 | 903K | |
![[SND]](/icons/sound2.gif) | [p5] improvised song dedicated to the next prime minister's ship.opus | 2021-05-02 21:17 | 904K | |
![[SND]](/icons/sound2.gif) | [dgs] ryunosuke's memories.opus | 2020-11-25 20:07 | 905K | |
![[SND]](/icons/sound2.gif) | [dgs] fiery people.opus | 2020-11-25 20:07 | 917K | |
![[SND]](/icons/sound2.gif) | [pkmn5] black city.opus | 2021-05-03 06:24 | 923K | |
![[SND]](/icons/sound2.gif) | [dgs2] surrounded by nothingness.opus | 2020-11-25 20:07 | 933K | |
![[SND]](/icons/sound2.gif) | [Kirby] Arena title screen.opus | 2024-09-21 00:48 | 935K | |
![[SND]](/icons/sound2.gif) | [p5] electronics store.opus | 2021-05-02 21:17 | 937K | |
![[SND]](/icons/sound2.gif) | [HDusk] Suspicions ~ HD.opus | 2023-07-03 00:16 | 942K | |
![[SND]](/icons/sound2.gif) | [aa] objection! ~ phoenix wright.opus | 2021-05-07 07:30 | 944K | |
![[SND]](/icons/sound2.gif) | [omori] you were wrong. go back.opus | 2022-10-28 17:54 | 945K | |
![[SND]](/icons/sound2.gif) | [p4] corner of memories.opus | 2021-05-02 19:51 | 949K | |
![[SND]](/icons/sound2.gif) | [p4] midnight channel.opus | 2021-05-02 19:51 | 950K | |
![[SND]](/icons/sound2.gif) | [dgs] investigation (core).opus | 2020-11-25 20:07 | 952K | |
![[SND]](/icons/sound2.gif) | [aa] courtroom lobby.opus | 2021-05-07 07:28 | 957K | |
![[SND]](/icons/sound2.gif) | [dgs2] asougi kazuma - a grand return.opus | 2020-11-25 20:07 | 957K | |
![[SND]](/icons/sound2.gif) | [dr] vs. susie.opus | 2021-05-01 19:28 | 960K | |
![[SND]](/icons/sound2.gif) | [dgs] mikotoba susato - blooming flower in the new world.opus | 2020-11-25 20:07 | 960K | |
![[SND]](/icons/sound2.gif) | [aa] blissful people (remix).opus | 2021-05-07 14:33 | 965K | |
![[SND]](/icons/sound2.gif) | [p4] how much.opus | 2021-05-02 19:51 | 965K | |
![[SND]](/icons/sound2.gif) | [dgs2] solo of rage.opus | 2020-11-25 20:07 | 966K | |
![[SND]](/icons/sound2.gif) | [dgs2] victory!.opus | 2020-11-25 20:07 | 973K | |
![[SND]](/icons/sound2.gif) | [dgs] the musings of sherlock holmes.opus | 2020-11-25 20:08 | 1.0M | |
![[SND]](/icons/sound2.gif) | [p5] broadcast accident.opus | 2021-05-02 21:16 | 1.0M | |
![[SND]](/icons/sound2.gif) | [p5] sweatshop -another version-.opus | 2021-05-02 21:18 | 1.0M | |
![[SND]](/icons/sound2.gif) | [dgs2] announce the truth.opus | 2020-11-25 20:07 | 1.0M | |
![[SND]](/icons/sound2.gif) | [p5] disintegration.opus | 2021-05-02 21:17 | 1.0M | |
![[SND]](/icons/sound2.gif) | [p4] awakening.opus | 2021-05-02 19:51 | 1.0M | |
![[SND]](/icons/sound2.gif) | [dgs] questioning (allegro).opus | 2020-11-25 20:07 | 1.0M | |
![[SND]](/icons/sound2.gif) | [p5] the spirit.opus | 2021-05-02 21:19 | 1.0M | |
![[SND]](/icons/sound2.gif) | [va-11 hall-a] every day is night.opus | 2022-10-28 12:28 | 1.0M | |
![[SND]](/icons/sound2.gif) | [dgs2] murder in the dark.opus | 2020-11-25 20:07 | 1.0M | |
![[SND]](/icons/sound2.gif) | [dgs] sherlock holmes - the great detective of the foggy town.opus | 2020-11-25 20:07 | 1.0M | |
![[SND]](/icons/sound2.gif) | [dgs] hart vortex - judge of time.opus | 2020-11-25 20:07 | 1.0M | |
![[SND]](/icons/sound2.gif) | [aajfa] pursuit.opus | 2021-05-07 12:51 | 1.0M | |
![[SND]](/icons/sound2.gif) | [dgs2] music box - the neverending great turnabout.opus | 2020-11-25 20:07 | 1.0M | |
![[SND]](/icons/sound2.gif) | [p3fes] p3 fes (opening).opus | 2021-05-02 19:41 | 1.0M | |
![[SND]](/icons/sound2.gif) | [aajfa] pearl fey ~ together with pearly.opus | 2021-05-07 12:51 | 1.0M | |
![[SND]](/icons/sound2.gif) | [spm] the ultimate show.opus | 2024-03-14 07:01 | 1.0M | |
![[SND]](/icons/sound2.gif) | [p4] reach out to the truth -inst version-.opus | 2021-05-02 19:52 | 1.0M | |
![[SND]](/icons/sound2.gif) | [umi] Mind.opus | 2024-04-07 15:38 | 1.0M | |
![[SND]](/icons/sound2.gif) | [dgs] serenade.opus | 2020-11-25 20:07 | 1.0M | |
![[SND]](/icons/sound2.gif) | [dr2] p.t.a. (hyper ultra).opus | 2021-04-29 12:40 | 1.0M | |
![[SND]](/icons/sound2.gif) | [p5] run away -another version-.opus | 2021-05-02 21:18 | 1.0M | |
![[SND]](/icons/sound2.gif) | [yttd] uzu.opus | 2021-08-31 00:04 | 1.0M | |
![[SND]](/icons/sound2.gif) | [p5] awakening.opus | 2021-05-02 21:16 | 1.0M | |
![[SND]](/icons/sound2.gif) | [dgs] detention center.opus | 2020-11-25 20:07 | 1.0M | |
![[SND]](/icons/sound2.gif) | [p4] pursuing my true self (opening).opus | 2021-05-02 19:52 | 1.0M | |
![[SND]](/icons/sound2.gif) | [aaaj] cross-examination ~ moderato.opus | 2021-05-07 07:36 | 1.0M | |
![[SND]](/icons/sound2.gif) | [p5] going through the scorching desert.opus | 2021-05-02 21:17 | 1.0M | |
![[SND]](/icons/sound2.gif) | [va-11 hall-a] a neon glow lights the way.opus | 2021-10-04 05:49 | 1.0M | |
![[SND]](/icons/sound2.gif) | [pkmn5] karakusa town.opus | 2021-05-03 06:25 | 1.0M | |
![[SND]](/icons/sound2.gif) | [p5r] that guy is a trick☆star→.opus | 2021-05-03 09:02 | 1.0M | |
![[SND]](/icons/sound2.gif) | [dr] checker dance.opus | 2021-05-01 19:28 | 1.0M | |
![[SND]](/icons/sound2.gif) | [p5] collapse of arrogance.opus | 2021-05-02 21:17 | 1.0M | |
![[SND]](/icons/sound2.gif) | [dgs2] bonds forged in travel.opus | 2020-11-25 20:07 | 1.0M | |
![[SND]](/icons/sound2.gif) | [dgs] asougi kazuma - nocturne.opus | 2020-11-25 20:07 | 1.0M | |
![[SND]](/icons/sound2.gif) | [dgs2] asougi kazuma - grand revival.opus | 2020-11-25 20:07 | 1.0M | |
![[SND]](/icons/sound2.gif) | [p5r] hatsumode.opus | 2021-05-03 09:01 | 1.0M | |
![[SND]](/icons/sound2.gif) | [dgs2] the legend of the baskervilles.opus | 2020-11-25 20:07 | 1.0M | |
![[SND]](/icons/sound2.gif) | [gt] 4 minutes before death ~ variation.opus | 2021-05-02 09:48 | 1.0M | |
![[SND]](/icons/sound2.gif) | [aaaj] ema skye ~ the scientific detective.opus | 2021-05-07 07:36 | 1.1M | |
![[SND]](/icons/sound2.gif) | [aa] confess the truth.opus | 2021-05-07 07:29 | 1.1M | |
![[SND]](/icons/sound2.gif) | [p5] alright.opus | 2021-05-02 21:16 | 1.1M | |
![[SND]](/icons/sound2.gif) | [aajfa] miles edgeworth ~ great revival.opus | 2021-05-07 12:50 | 1.1M | |
![[SND]](/icons/sound2.gif) | [dgs] trial in disarray.opus | 2020-11-25 20:08 | 1.1M | |
![[SND]](/icons/sound2.gif) | [dr] school.opus | 2021-05-01 19:28 | 1.1M | |
![[SND]](/icons/sound2.gif) | [dgs] closing argument.opus | 2020-11-25 20:07 | 1.1M | |
![[SND]](/icons/sound2.gif) | [aajfa] franziska von karma ~ great revival.opus | 2021-05-07 12:50 | 1.1M | |
![[SND]](/icons/sound2.gif) | [dgs] asougi kazuma - heritage of the samurai.opus | 2020-11-25 20:07 | 1.1M | |
![[SND]](/icons/sound2.gif) | [dgs2] partners - a reasoning battle.opus | 2020-11-25 20:07 | 1.1M | |
![[SND]](/icons/sound2.gif) | [aajfa] tricks and magic.opus | 2021-05-07 12:51 | 1.1M | |
![[SND]](/icons/sound2.gif) | [dgs] pursuit.opus | 2020-11-25 20:07 | 1.1M | |
![[SND]](/icons/sound2.gif) | [p4] muscle blues.opus | 2021-05-02 19:52 | 1.1M | |
![[SND]](/icons/sound2.gif) | [aa] suspense (darude sandstorm).opus | 2021-05-07 14:34 | 1.1M | |
![[SND]](/icons/sound2.gif) | [p5] wake up, get up, get out there -opening movie version-.opus | 2021-05-02 21:19 | 1.1M | |
![[SND]](/icons/sound2.gif) | [ut] once upon a time.opus | 2021-05-03 12:47 | 1.1M | |
![[SND]](/icons/sound2.gif) | [p5r] colors flying high -opening movie version-.opus | 2021-05-03 09:01 | 1.1M | |
![[SND]](/icons/sound2.gif) | [p5] is it boring.opus | 2021-05-02 21:17 | 1.1M | |
![[SND]](/icons/sound2.gif) | [Baby Shark] Baby Shark.opus | 2024-09-05 01:30 | 1.1M | |
![[SND]](/icons/sound2.gif) | [dr] chaos king.opus | 2021-05-01 19:27 | 1.1M | |
![[SND]](/icons/sound2.gif) | [ahit] snatcher's contractual obligations.opus | 2021-05-01 17:18 | 1.1M | |
![[SND]](/icons/sound2.gif) | [dgs2] trial.opus | 2020-11-25 20:07 | 1.1M | |
![[SND]](/icons/sound2.gif) | [hk] enter hallownest.opus | 2021-05-02 10:21 | 1.1M | |
![[SND]](/icons/sound2.gif) | [dr] pandora palace.opus | 2021-12-09 17:56 | 1.1M | |
![[SND]](/icons/sound2.gif) | [aaaj] trucy wright ~ child of magic.opus | 2021-05-07 07:38 | 1.1M | |
![[SND]](/icons/sound2.gif) | [dgs] hate the sins, not the sinner.opus | 2020-11-25 20:07 | 1.1M | |
![[SND]](/icons/sound2.gif) | [dgs] vanished fairy.opus | 2020-11-25 20:08 | 1.1M | |
![[SND]](/icons/sound2.gif) | [dr] lost girl.opus | 2021-12-09 17:56 | 1.1M | |
![[SND]](/icons/sound2.gif) | [dgs] trial.opus | 2020-11-25 20:08 | 1.1M | |
![[SND]](/icons/sound2.gif) | [umi] Hour of darkness.opus | 2024-04-07 14:58 | 1.1M | |
![[SND]](/icons/sound2.gif) | [p5] price -another version-.opus | 2021-05-02 21:18 | 1.1M | |
![[SND]](/icons/sound2.gif) | [dr] the world revolving.opus | 2021-05-01 19:28 | 1.1M | |
![[SND]](/icons/sound2.gif) | [p5] interrogation room.opus | 2021-05-02 21:17 | 1.1M | |
![[SND]](/icons/sound2.gif) | [p5] high pressure.opus | 2021-05-02 21:17 | 1.1M | |
![[SND]](/icons/sound2.gif) | [dgs2] partners - the game is afoot!.opus | 2020-11-25 20:07 | 1.1M | |
![[SND]](/icons/sound2.gif) | [va-11 hall-a] safe haven.opus | 2021-10-04 05:50 | 1.1M | |
![[SND]](/icons/sound2.gif) | [p5] alright -elp version-.opus | 2021-05-02 21:16 | 1.1M | |
![[SND]](/icons/sound2.gif) | [aaaj] objection! ~ apollo justice.opus | 2021-05-07 07:37 | 1.1M | |
![[SND]](/icons/sound2.gif) | [dgs2] intersecting murders.opus | 2020-11-25 20:07 | 1.1M | |
![[SND]](/icons/sound2.gif) | [aa] pursuit.opus | 2021-05-07 07:30 | 1.1M | |
![[SND]](/icons/sound2.gif) | [celeste] reconciliation.opus | 2021-05-01 19:13 | 1.2M | |
![[SND]](/icons/sound2.gif) | [HDusk] High Spirits ~ HD.opus | 2023-07-03 01:12 | 1.2M | |
![[SND]](/icons/sound2.gif) | [gt] the world of the dead.opus | 2021-05-02 09:49 | 1.2M | |
![[SND]](/icons/sound2.gif) | [p5] mementos.opus | 2021-05-02 21:18 | 1.2M | |
![[SND]](/icons/sound2.gif) | [aat&t] victor kudo ~ how sad, the melody of this war song.opus | 2021-05-07 13:22 | 1.2M | |
![[SND]](/icons/sound2.gif) | [ut] alphys.opus | 2021-05-03 12:46 | 1.2M | |
![[SND]](/icons/sound2.gif) | [p5] run away ~ arrest.opus | 2021-05-02 21:18 | 1.2M | |
![[SND]](/icons/sound2.gif) | [p4] zone time.opus | 2021-05-02 19:53 | 1.2M | |
![[SND]](/icons/sound2.gif) | [dgs] verdict.opus | 2020-11-25 20:08 | 1.2M | |
![[SND]](/icons/sound2.gif) | [dgs2] each one's path.opus | 2020-11-25 20:07 | 1.2M | |
![[SND]](/icons/sound2.gif) | [p5] a woman -another version-.opus | 2021-05-02 21:16 | 1.2M | |
![[SND]](/icons/sound2.gif) | [p5] sunset bridge.opus | 2021-05-02 21:18 | 1.2M | |
![[SND]](/icons/sound2.gif) | [pkmn5] hodomoe city.opus | 2021-05-03 06:25 | 1.2M | |
![[SND]](/icons/sound2.gif) | [m3] porky's pokies.opus | 2021-05-02 14:02 | 1.2M | |
![[SND]](/icons/sound2.gif) | [va-11 hall-a] your love is a drug.opus | 2021-10-04 05:49 | 1.2M | |
![[SND]](/icons/sound2.gif) | [p5] blood of villain.opus | 2021-05-02 21:16 | 1.2M | |
![[SND]](/icons/sound2.gif) | [ut] hotel.opus | 2021-05-03 12:47 | 1.2M | |
![[SND]](/icons/sound2.gif) | [aaaj] klavier gavin ~ guilty love.opus | 2021-05-07 07:37 | 1.2M | |
![[SND]](/icons/sound2.gif) | [HDusk] Easy Feeling ~ HD.opus | 2023-07-03 00:49 | 1.2M | |
![[SND]](/icons/sound2.gif) | [aat&t] mask☆demasque ~ pleeeeease listen!.opus | 2021-05-07 13:21 | 1.2M | |
![[SND]](/icons/sound2.gif) | [pkmn6] elite 4 (oras remaster).opus | 2023-10-15 06:46 | 1.2M | |
![[SND]](/icons/sound2.gif) | [aaaj] pursuit.opus | 2021-05-07 07:37 | 1.2M | |
![[SND]](/icons/sound2.gif) | [dr2] 5th island theme song.opus | 2021-04-29 12:40 | 1.2M | |
![[SND]](/icons/sound2.gif) | [aa] objection funk.opus | 2021-05-07 14:33 | 1.2M | |
![[SND]](/icons/sound2.gif) | [aajfa] objection! ~ phoenix wright.opus | 2021-05-07 12:50 | 1.2M | |
![[SND]](/icons/sound2.gif) | [va-11 hall-a] snowfall.opus | 2021-10-04 05:50 | 1.2M | |
![[SND]](/icons/sound2.gif) | [va-11 hall-a] welcome to va-11 hall-a.opus | 2021-10-04 05:50 | 1.2M | |
![[SND]](/icons/sound2.gif) | [HDusk] Straight Chaser ~ HD.opus | 2023-07-03 00:57 | 1.2M | |
![[SND]](/icons/sound2.gif) | [p4] theater.opus | 2021-05-02 19:52 | 1.2M | |
![[SND]](/icons/sound2.gif) | [dgs] london - the foggy city.opus | 2020-11-25 20:07 | 1.2M | |
![[SND]](/icons/sound2.gif) | [p4] someone else's man.opus | 2021-05-02 19:52 | 1.3M | |
![[SND]](/icons/sound2.gif) | [dgs2] shattered formulas.opus | 2020-11-25 20:07 | 1.3M | |
![[SND]](/icons/sound2.gif) | [ut] spider dance.opus | 2021-05-03 12:47 | 1.3M | |
![[SND]](/icons/sound2.gif) | [HDusk] So Noted ~ HD.opus | 2023-07-03 01:11 | 1.3M | |
![[SND]](/icons/sound2.gif) | [p4] youthful lunch.opus | 2021-05-02 19:53 | 1.3M | |
![[SND]](/icons/sound2.gif) | [p5] price.opus | 2021-05-02 21:18 | 1.3M | |
![[SND]](/icons/sound2.gif) | [aaaj] troupe gramarye.opus | 2021-05-07 07:38 | 1.3M | |
![[SND]](/icons/sound2.gif) | [dgs2] at ambition's end.opus | 2020-11-25 20:07 | 1.3M | |
![[SND]](/icons/sound2.gif) | [dgs] announce the truth.opus | 2020-11-25 20:07 | 1.3M | |
![[SND]](/icons/sound2.gif) | [umi] Tsubasa.opus | 2024-04-08 20:53 | 1.3M | |
![[SND]](/icons/sound2.gif) | [aajfa] confess the truth.opus | 2021-05-07 12:50 | 1.3M | |
![[SND]](/icons/sound2.gif) | [p4] everyday's great at your junes!.opus | 2021-05-02 19:51 | 1.3M | |
![[SND]](/icons/sound2.gif) | [p5] break it down -elp version-.opus | 2021-05-02 21:16 | 1.3M | |
![[SND]](/icons/sound2.gif) | [aaaj] cross-examination ~ allegro.opus | 2021-05-07 07:36 | 1.3M | |
![[SND]](/icons/sound2.gif) | [aajfa] berry big circus.opus | 2021-05-07 12:49 | 1.3M | |
![[SND]](/icons/sound2.gif) | [yttd] pani2 (major panic b).opus | 2021-08-31 00:04 | 1.3M | |
![[SND]](/icons/sound2.gif) | [p5] king, queen and slave -another version-.opus | 2021-05-02 21:17 | 1.3M | |
![[SND]](/icons/sound2.gif) | [va-11 hall-a] a rene.opus | 2021-10-04 05:50 | 1.3M | |
![[SND]](/icons/sound2.gif) | [yttd] madman (kyoujin).opus | 2021-05-04 10:52 | 1.3M | |
![[SND]](/icons/sound2.gif) | [ut] finale.opus | 2021-05-03 12:46 | 1.3M | |
![[SND]](/icons/sound2.gif) | [aajfa] cross-examination ~ moderato.opus | 2021-05-07 12:50 | 1.3M | |
![[SND]](/icons/sound2.gif) | [hk] mantis lords.opus | 2021-05-02 10:21 | 1.3M | |
![[SND]](/icons/sound2.gif) | [p5] break it down.opus | 2021-05-02 21:16 | 1.3M | |
![[SND]](/icons/sound2.gif) | [umi] White shadow.opus | 2024-04-07 15:05 | 1.3M | |
![[SND]](/icons/sound2.gif) | [ut] heartache.opus | 2021-05-03 12:46 | 1.3M | |
![[SND]](/icons/sound2.gif) | [dr1] b.t.b..opus | 2021-04-29 08:41 | 1.3M | |
![[SND]](/icons/sound2.gif) | [aa] jake marshall ~ detective from the wild west.opus | 2021-05-07 07:29 | 1.3M | |
![[SND]](/icons/sound2.gif) | [p4] the path is open (p4ver.).opus | 2021-05-02 19:52 | 1.3M | |
![[SND]](/icons/sound2.gif) | [umi] Eternal Chains.opus | 2024-04-08 21:01 | 1.3M | |
![[SND]](/icons/sound2.gif) | [celeste] anxiety.opus | 2021-05-01 19:12 | 1.3M | |
![[SND]](/icons/sound2.gif) | [dr2] welcome to dangan island!.opus | 2021-04-29 12:40 | 1.3M | |
![[SND]](/icons/sound2.gif) | [aat&t] furio tigre ~ swingin' tiger.opus | 2021-05-07 13:21 | 1.3M | |
![[SND]](/icons/sound2.gif) | [dgs2] the professor - the phantom lives.opus | 2020-11-25 20:07 | 1.4M | |
![[SND]](/icons/sound2.gif) | [HDusk] Drunken Waltz ~ HD.opus | 2023-07-03 01:09 | 1.4M | |
![[SND]](/icons/sound2.gif) | [aat&t] luke atmey ~ look at me.opus | 2021-05-07 13:21 | 1.4M | |
![[SND]](/icons/sound2.gif) | [dgs] investigation (opening).opus | 2020-11-25 20:07 | 1.4M | |
![[SND]](/icons/sound2.gif) | [p5] the days when my mother was there -another version-.opus | 2021-05-02 21:19 | 1.4M | |
![[SND]](/icons/sound2.gif) | [aai2] confrontation ~ presto.opus | 2021-05-07 12:07 | 1.4M | |
![[SND]](/icons/sound2.gif) | [dr2] class trial - future.opus | 2021-04-29 12:40 | 1.4M | |
![[SND]](/icons/sound2.gif) | [pkmn6] lumiose city.opus | 2021-05-03 06:35 | 1.4M | |
![[SND]](/icons/sound2.gif) | [ut] spear of justice.opus | 2021-05-03 12:47 | 1.4M | |
![[SND]](/icons/sound2.gif) | [999] 9 hours 9 persons 9 doors.opus | 2021-05-02 14:12 | 1.4M | |
![[SND]](/icons/sound2.gif) | [p5] ark.opus | 2021-05-02 21:16 | 1.4M | |
![[SND]](/icons/sound2.gif) | [aajfa] shelly de killer ~ the whim of a murderous gentleman.opus | 2021-05-07 12:51 | 1.4M | |
![[SND]](/icons/sound2.gif) | [gt] missile ~ a courageous little animal.opus | 2021-05-02 09:49 | 1.4M | |
![[SND]](/icons/sound2.gif) | [pkmn6] final battle! (rival) [pokemon origins version].opus | 2021-05-03 06:34 | 1.4M | |
![[SND]](/icons/sound2.gif) | [p4] strength of heart (p4ver.).opus | 2021-05-02 19:52 | 1.4M | |
![[SND]](/icons/sound2.gif) | [gt] deadline.opus | 2021-05-02 09:48 | 1.4M | |
![[SND]](/icons/sound2.gif) | [aajfa] cross-examination ~ allegro.opus | 2021-05-07 12:49 | 1.4M | |
![[SND]](/icons/sound2.gif) | [pkmn5] hiun city.opus | 2021-05-03 06:25 | 1.4M | |
![[SND]](/icons/sound2.gif) | [pkmn5] raimon city.opus | 2021-05-03 06:25 | 1.4M | |
![[SND]](/icons/sound2.gif) | [dr] the legend.opus | 2021-05-01 19:28 | 1.4M | |
![[SND]](/icons/sound2.gif) | [umi] Puppet Show.opus | 2024-04-08 21:32 | 1.4M | |
![[SND]](/icons/sound2.gif) | [p5] run,run,run!.opus | 2021-05-02 21:18 | 1.4M | |
![[SND]](/icons/sound2.gif) | [wii] mii channel theme.opus | 2021-05-06 08:50 | 1.4M | |
![[SND]](/icons/sound2.gif) | [dr2] trapped by the ocean scent.opus | 2021-04-29 12:40 | 1.4M | |
![[SND]](/icons/sound2.gif) | [gt] trauma.opus | 2021-05-02 09:49 | 1.4M | |
![[SND]](/icons/sound2.gif) | [aa] cross-examination ~ moderato.opus | 2024-09-04 21:40 | 1.4M | |
![[SND]](/icons/sound2.gif) | [aa] court begins.opus | 2021-05-07 07:29 | 1.4M | |
![[SND]](/icons/sound2.gif) | [va-11 hall-a] you've got me.opus | 2021-10-04 05:49 | 1.4M | |
![[SND]](/icons/sound2.gif) | [dgs] iris watson - a little biographer.opus | 2020-11-25 20:07 | 1.4M | |
![[SND]](/icons/sound2.gif) | [p4] sauna.opus | 2021-05-02 19:52 | 1.4M | |
![[SND]](/icons/sound2.gif) | [umi] HANE.opus | 2024-04-07 14:58 | 1.4M | |
![[SND]](/icons/sound2.gif) | [aa] investigation ~ core.opus | 2021-05-07 07:29 | 1.4M | |
![[SND]](/icons/sound2.gif) | [aa] suspense.opus | 2021-05-07 07:30 | 1.4M | |
![[SND]](/icons/sound2.gif) | [dr2] from me to you too (feat. ibuki mioda).opus | 2021-04-29 12:40 | 1.4M | |
![[SND]](/icons/sound2.gif) | [aaaj] trance logic.opus | 2021-05-07 07:38 | 1.4M | |
![[SND]](/icons/sound2.gif) | [aat&t] pursuit.opus | 2021-05-07 13:21 | 1.4M | |
![[SND]](/icons/sound2.gif) | [p4] who's there.opus | 2021-05-02 19:53 | 1.4M | |
![[SND]](/icons/sound2.gif) | [Kirby] Battle - The arena.opus | 2024-09-21 00:49 | 1.4M | |
![[SND]](/icons/sound2.gif) | [gt] towards nothingness....opus | 2021-05-02 09:49 | 1.4M | |
![[SND]](/icons/sound2.gif) | [dr] big shot.opus | 2021-12-09 17:56 | 1.4M | |
![[SND]](/icons/sound2.gif) | [Kirby] Dedede's royal payback.opus | 2024-09-21 00:49 | 1.4M | |
![[SND]](/icons/sound2.gif) | [p5] restlessness.opus | 2021-05-02 21:18 | 1.4M | |
![[SND]](/icons/sound2.gif) | [dr2] alter ego of the new world.opus | 2021-04-29 12:40 | 1.5M | |
![[SND]](/icons/sound2.gif) | [umi] Ageha [Swallowtail Butterfly].opus | 2024-04-08 02:45 | 1.5M | |
![[SND]](/icons/sound2.gif) | [HDusk] Over Easy ~ HD.opus | 2023-07-03 01:14 | 1.5M | |
![[SND]](/icons/sound2.gif) | [dgs2] the grim reaper's memories.opus | 2020-11-25 20:07 | 1.5M | |
![[SND]](/icons/sound2.gif) | [HDusk] Rainy Night ~ HD.opus | 2023-07-03 00:58 | 1.5M | |
![[SND]](/icons/sound2.gif) | [p5] tension.opus | 2021-05-02 21:19 | 1.5M | |
![[SND]](/icons/sound2.gif) | [aadgs2] pursuit.opus | 2021-05-07 08:30 | 1.5M | |
![[SND]](/icons/sound2.gif) | [m2] giygas theme.opus | 2024-04-16 19:55 | 1.5M | |
![[SND]](/icons/sound2.gif) | [p4] the genesis (uplifting verse).opus | 2021-05-02 19:52 | 1.5M | |
![[SND]](/icons/sound2.gif) | [gt] chase.opus | 2021-05-02 09:48 | 1.5M | |
![[SND]](/icons/sound2.gif) | [p4a] yu narukami - reach out to the truth.opus | 2021-05-02 21:02 | 1.5M | |
![[SND]](/icons/sound2.gif) | [aa] dick gumshoe ~ it's detective gumshoe, pal!.opus | 2021-05-07 07:29 | 1.5M | |
![[SND]](/icons/sound2.gif) | [p5] a woman.opus | 2021-05-02 21:16 | 1.5M | |
![[SND]](/icons/sound2.gif) | [gt] complication.opus | 2021-05-02 09:48 | 1.5M | |
![[SND]](/icons/sound2.gif) | [drv3] our class trial.opus | 2021-04-30 11:38 | 1.5M | |
![[SND]](/icons/sound2.gif) | [hk] dirtmouth.opus | 2021-05-02 10:21 | 1.5M | |
![[SND]](/icons/sound2.gif) | [HDusk] Desert Highway ~ HD.opus | 2023-07-02 23:38 | 1.5M | |
![[SND]](/icons/sound2.gif) | [p5] my homie.opus | 2021-05-02 21:18 | 1.5M | |
![[SND]](/icons/sound2.gif) | [p4] i'll face myself -another version-.opus | 2021-05-02 19:51 | 1.5M | |
![[SND]](/icons/sound2.gif) | [p5] king, queen and slave.opus | 2021-05-02 21:17 | 1.5M | |
![[SND]](/icons/sound2.gif) | [pkmn6] an unwavering heart.opus | 2021-05-03 06:34 | 1.5M | |
![[SND]](/icons/sound2.gif) | [touhou] night falls ~ evening star.opus | 2022-12-28 13:40 | 1.5M | |
![[SND]](/icons/sound2.gif) | [dr] scarlet forest.opus | 2021-05-01 19:28 | 1.5M | |
![[SND]](/icons/sound2.gif) | [dr1] b.t.b. (super final).opus | 2021-04-29 08:41 | 1.5M | |
![[SND]](/icons/sound2.gif) | [s1] calamari inkantation.opus | 2021-05-04 16:42 | 1.5M | |
![[SND]](/icons/sound2.gif) | [gt] kuneri ~ a ray of light.opus | 2021-05-02 09:48 | 1.5M | |
![[SND]](/icons/sound2.gif) | [p5r] i will give you....opus | 2021-05-03 09:01 | 1.5M | |
![[SND]](/icons/sound2.gif) | [p5] tokyo daylight.opus | 2021-05-02 21:19 | 1.5M | |
![[SND]](/icons/sound2.gif) | [umi] Rest.opus | 2024-04-08 02:19 | 1.5M | |
![[SND]](/icons/sound2.gif) | [dr1] underground trial.opus | 2021-04-29 08:41 | 1.5M | |
![[SND]](/icons/sound2.gif) | [ut] snowy.opus | 2021-05-03 12:47 | 1.5M | |
![[SND]](/icons/sound2.gif) | [aat&t] objection! ~ phoenix wright.opus | 2021-05-07 13:21 | 1.5M | |
![[SND]](/icons/sound2.gif) | [p4a] naoto shirogane - seeker of truth.opus | 2021-05-02 21:02 | 1.5M | |
![[SND]](/icons/sound2.gif) | [dr2] p.t.a..opus | 2021-04-29 12:39 | 1.5M | |
![[SND]](/icons/sound2.gif) | [HDusk] Silent Moon ~ HD.opus | 2023-07-03 00:20 | 1.5M | |
![[SND]](/icons/sound2.gif) | [drv3] let's start the killing game.opus | 2021-04-30 11:37 | 1.5M | |
![[SND]](/icons/sound2.gif) | [p4au] tohru adachi - a fool or clown.opus | 2021-05-02 21:02 | 1.5M | |
![[SND]](/icons/sound2.gif) | [drv3] hangman's gambit 3.0.opus | 2021-04-30 11:37 | 1.5M | |
![[SND]](/icons/sound2.gif) | [aa] ema skye ~ turnabout sisters theme.opus | 2021-05-07 07:29 | 1.5M | |
![[SND]](/icons/sound2.gif) | [umi] Daydreams end.opus | 2024-04-08 02:45 | 1.5M | |
![[SND]](/icons/sound2.gif) | [pkmn5] sazanami town (autumn, spring, and winter).opus | 2021-05-03 06:25 | 1.5M | |
![[SND]](/icons/sound2.gif) | [omori] bready steady go.opus | 2021-05-21 06:42 | 1.5M | |
![[SND]](/icons/sound2.gif) | [pkmn1] lavender town's theme.opus | 2021-05-03 06:21 | 1.5M | |
![[SND]](/icons/sound2.gif) | [dgs] barok van zieks - grim reaper of the great court.opus | 2020-11-25 20:07 | 1.6M | |
![[SND]](/icons/sound2.gif) | [HDusk] Monochrome ~ HD.opus | 2023-07-03 00:56 | 1.6M | |
![[SND]](/icons/sound2.gif) | [p5] with the stars and us -piano version-.opus | 2021-05-02 21:19 | 1.6M | |
![[SND]](/icons/sound2.gif) | [p5] what's going on.opus | 2021-05-02 21:19 | 1.6M | |
![[SND]](/icons/sound2.gif) | [aai] crisis of fate.opus | 2021-05-07 09:28 | 1.6M | |
![[SND]](/icons/sound2.gif) | [gt] beauty and dandy.opus | 2021-05-02 09:48 | 1.6M | |
![[SND]](/icons/sound2.gif) | [umi] 599 million ruins.opus | 2024-04-08 05:19 | 1.6M | |
![[SND]](/icons/sound2.gif) | [aa] cross-examination ~ allegro.opus | 2021-05-07 07:29 | 1.6M | |
![[SND]](/icons/sound2.gif) | [999] unary game.opus | 2021-05-02 14:14 | 1.6M | |
![[SND]](/icons/sound2.gif) | [p4] border of insanity.opus | 2021-05-02 19:51 | 1.6M | |
![[SND]](/icons/sound2.gif) | [aajfa] investigation ~ core.opus | 2021-05-07 12:50 | 1.6M | |
![[SND]](/icons/sound2.gif) | [aa] damon gant ~ swimming, anyone.opus | 2021-05-07 07:29 | 1.6M | |
![[SND]](/icons/sound2.gif) | [hk] radiance.opus | 2021-05-02 10:21 | 1.6M | |
![[SND]](/icons/sound2.gif) | [yttd] major panic.opus | 2021-05-04 10:52 | 1.6M | |
![[SND]](/icons/sound2.gif) | [ut] death by glamour.opus | 2021-05-03 12:46 | 1.6M | |
![[SND]](/icons/sound2.gif) | [mgrr] rules of nature.opus | 2021-05-10 06:16 | 1.6M | |
![[SND]](/icons/sound2.gif) | [umi] Core.opus | 2024-04-07 15:38 | 1.6M | |
![[SND]](/icons/sound2.gif) | [gt] madam ~ an enveloping smell of roses.opus | 2021-05-02 09:48 | 1.6M | |
![[SND]](/icons/sound2.gif) | [p5] phantom.opus | 2021-05-02 21:18 | 1.6M | |
![[SND]](/icons/sound2.gif) | [p5] days of sisters.opus | 2021-05-02 21:17 | 1.6M | |
![[SND]](/icons/sound2.gif) | [p4] alone.opus | 2021-05-02 19:51 | 1.6M | |
![[SND]](/icons/sound2.gif) | [hk] the grimm troupe.opus | 2021-05-02 10:21 | 1.6M | |
![[SND]](/icons/sound2.gif) | [aat&t] larry butz ~ when something smells, it's usually me.opus | 2021-05-07 13:21 | 1.6M | |
![[SND]](/icons/sound2.gif) | [aat&t] confess the truth.opus | 2021-05-07 13:20 | 1.6M | |
![[SND]](/icons/sound2.gif) | [p5] have a short rest.opus | 2021-05-02 21:17 | 1.6M | |
![[SND]](/icons/sound2.gif) | [umi] Answer.opus | 2024-04-08 02:19 | 1.6M | |
![[SND]](/icons/sound2.gif) | [dr kill cure] discussion -hope vs despair-.opus | 2021-05-01 09:39 | 1.6M | |
![[SND]](/icons/sound2.gif) | [p4] heartbeat,heartbeat.opus | 2021-05-02 19:51 | 1.6M | |
![[SND]](/icons/sound2.gif) | [p3] want to be close.opus | 2021-05-02 19:32 | 1.6M | |
![[SND]](/icons/sound2.gif) | [gt] 4 minutes before death.opus | 2021-05-02 09:48 | 1.6M | |
![[SND]](/icons/sound2.gif) | [p3] deep breath deep breath.opus | 2021-05-02 19:32 | 1.6M | |
![[SND]](/icons/sound2.gif) | [va-11 hall-a] dawn approaches.opus | 2021-10-04 05:50 | 1.6M | |
![[SND]](/icons/sound2.gif) | [p5] sweet.opus | 2021-05-02 21:19 | 1.7M | |
![[SND]](/icons/sound2.gif) | [aai] kay faraday ~ the great truth burglar.opus | 2021-05-07 09:29 | 1.7M | |
![[SND]](/icons/sound2.gif) | [p4] specialist.opus | 2021-05-02 19:52 | 1.7M | |
![[SND]](/icons/sound2.gif) | [yttd] prayer.opus | 2021-05-04 10:52 | 1.7M | |
![[SND]](/icons/sound2.gif) | [p3p] a way of life.opus | 2021-05-02 19:46 | 1.7M | |
![[SND]](/icons/sound2.gif) | [p4g] time to make history.opus | 2021-05-02 21:10 | 1.7M | |
![[SND]](/icons/sound2.gif) | [HDusk] On The Rocks ~ HD.opus | 2023-07-03 00:22 | 1.7M | |
![[SND]](/icons/sound2.gif) | [p3p] sun.opus | 2021-05-02 19:46 | 1.7M | |
![[SND]](/icons/sound2.gif) | [HDusk] Hotel Dusk ~ HD.opus | 2023-07-03 01:06 | 1.7M | |
![[SND]](/icons/sound2.gif) | [yttd] abareru1 (rampage a).opus | 2021-08-31 00:03 | 1.7M | |
![[SND]](/icons/sound2.gif) | [yttd] not so, sou ab.opus | 2021-08-31 00:04 | 1.7M | |
![[SND]](/icons/sound2.gif) | [gt] cabanela ~ a lanky man in lovely white.opus | 2021-05-02 09:48 | 1.7M | |
![[SND]](/icons/sound2.gif) | [p4] corridor.opus | 2021-05-02 19:51 | 1.7M | |
![[SND]](/icons/sound2.gif) | [ut] dummy!.opus | 2021-05-03 12:46 | 1.7M | |
![[SND]](/icons/sound2.gif) | [Kirby] Moonstruck Blossom.opus | 2024-09-21 00:50 | 1.7M | |
![[SND]](/icons/sound2.gif) | [dgs2] ending.opus | 2020-11-25 20:07 | 1.7M | |
![[SND]](/icons/sound2.gif) | [aai] amusing people.opus | 2021-05-07 09:28 | 1.7M | |
![[SND]](/icons/sound2.gif) | [umi] Organ Short 600.opus | 2024-04-07 15:52 | 1.7M | |
![[SND]](/icons/sound2.gif) | [HDusk] Bright Crystal ~ HD.opus | 2023-07-03 00:50 | 1.7M | |
![[SND]](/icons/sound2.gif) | [p5] sweatshop.opus | 2021-05-02 21:19 | 1.7M | |
![[SND]](/icons/sound2.gif) | [p4] new days.opus | 2021-05-02 19:52 | 1.7M | |
![[SND]](/icons/sound2.gif) | [umi] Dir.opus | 2024-04-08 05:29 | 1.7M | |
![[SND]](/icons/sound2.gif) | [p5] life will change -instrumental version-.opus | 2021-05-02 21:18 | 1.7M | |
![[SND]](/icons/sound2.gif) | [pkmn6] snowbelle city.opus | 2021-05-03 06:35 | 1.7M | |
![[SND]](/icons/sound2.gif) | [HDusk] Play It Again ~ HD.opus | 2023-07-03 00:18 | 1.7M | |
![[SND]](/icons/sound2.gif) | [gt] ghost trick.opus | 2021-05-02 09:49 | 1.7M | |
![[SND]](/icons/sound2.gif) | [ut] home.opus | 2021-05-03 12:47 | 1.7M | |
![[SND]](/icons/sound2.gif) | [aai] confess the truth.opus | 2021-05-07 09:28 | 1.7M | |
![[SND]](/icons/sound2.gif) | [drv3] outlaw run.opus | 2021-04-30 11:38 | 1.7M | |
![[SND]](/icons/sound2.gif) | [va-11 hall-a] synthestitch.opus | 2021-10-04 05:50 | 1.7M | |
![[SND]](/icons/sound2.gif) | [gt] awakening.opus | 2021-05-02 09:48 | 1.7M | |
![[SND]](/icons/sound2.gif) | [p4] long way.opus | 2021-05-02 19:51 | 1.8M | |
![[SND]](/icons/sound2.gif) | [p5] layer cake.opus | 2021-05-02 21:17 | 1.8M | |
![[SND]](/icons/sound2.gif) | [ut] megalovania.opus | 2021-05-03 12:47 | 1.8M | |
![[SND]](/icons/sound2.gif) | [p5] suspicion.opus | 2021-05-02 21:18 | 1.8M | |
![[SND]](/icons/sound2.gif) | [HDusk] Hangover Blues ~ HD.opus | 2023-07-03 00:48 | 1.8M | |
![[SND]](/icons/sound2.gif) | [aai2] pursuit.opus | 2021-05-07 12:08 | 1.8M | |
![[SND]](/icons/sound2.gif) | [dr1] danganronpa!.opus | 2021-04-29 08:40 | 1.8M | |
![[SND]](/icons/sound2.gif) | [p5] wicked plan.opus | 2021-05-02 21:19 | 1.8M | |
![[SND]](/icons/sound2.gif) | [ut] another medium.opus | 2024-09-04 21:40 | 1.8M | |
![[SND]](/icons/sound2.gif) | [p4au] sho minazuki - the joker (sho's theme).opus | 2021-05-02 21:02 | 1.8M | |
![[SND]](/icons/sound2.gif) | [p3] when the moon's reaching out stars.opus | 2021-05-02 19:32 | 1.8M | |
![[SND]](/icons/sound2.gif) | [p5] butterfly kiss.opus | 2021-05-02 21:17 | 1.8M | |
![[SND]](/icons/sound2.gif) | [omori] world's end valentine.opus | 2021-05-21 06:51 | 1.8M | |
![[SND]](/icons/sound2.gif) | [p4] reach out to the truth.opus | 2021-05-02 19:52 | 1.8M | |
![[SND]](/icons/sound2.gif) | [ut] asgore.opus | 2021-05-03 12:46 | 1.8M | |
![[SND]](/icons/sound2.gif) | [umi] Happiness of marionette -Omake.opus | 2024-04-08 02:50 | 1.8M | |
![[SND]](/icons/sound2.gif) | [p5] will power.opus | 2021-05-02 21:19 | 1.8M | |
![[SND]](/icons/sound2.gif) | [p4] secret base.opus | 2021-05-02 19:52 | 1.8M | |
![[SND]](/icons/sound2.gif) | [gt] the imprisoned.opus | 2021-05-02 09:49 | 1.8M | |
![[SND]](/icons/sound2.gif) | [yttd] abareru2 (rampage b).opus | 2021-08-31 00:03 | 1.8M | |
![[SND]](/icons/sound2.gif) | [umi] A Single Moment.opus | 2024-04-08 21:01 | 1.8M | |
![[SND]](/icons/sound2.gif) | [yttd] hazama2.opus | 2021-08-31 00:03 | 1.8M | |
![[SND]](/icons/sound2.gif) | [drv3] discussion v3 -panic-.opus | 2021-04-30 11:35 | 1.8M | |
![[SND]](/icons/sound2.gif) | [umi] The great detective knows.opus | 2024-04-08 16:29 | 1.8M | |
![[SND]](/icons/sound2.gif) | [p3] iwatodai dorm.opus | 2021-05-02 19:32 | 1.8M | |
![[SND]](/icons/sound2.gif) | [HDusk] Pink Rabbit ~ HD.opus | 2023-07-03 00:48 | 1.8M | |
![[SND]](/icons/sound2.gif) | [s1] i am octavio - phase 1.opus | 2021-05-04 16:43 | 1.8M | |
![[SND]](/icons/sound2.gif) | [aat&t] godot ~ the fragrance of dark coffee.opus | 2021-05-07 13:21 | 1.8M | |
![[SND]](/icons/sound2.gif) | [p5] life goes on.opus | 2021-05-02 21:18 | 1.8M | |
![[SND]](/icons/sound2.gif) | [drv3] heartless journey.opus | 2021-04-30 11:37 | 1.9M | |
![[SND]](/icons/sound2.gif) | [gt] reincarnation.opus | 2021-05-02 09:49 | 1.9M | |
![[SND]](/icons/sound2.gif) | [omori] you cannot go back.opus | 2021-05-21 06:51 | 1.9M | |
![[SND]](/icons/sound2.gif) | [p5] tokyo emergency.opus | 2021-05-02 21:19 | 1.9M | |
![[SND]](/icons/sound2.gif) | [aat&t] dahlia hawthorne ~ distant image.opus | 2021-05-07 13:20 | 1.9M | |
![[SND]](/icons/sound2.gif) | [HDusk] Dream's End ~ HD.opus | 2023-07-03 01:11 | 1.9M | |
![[SND]](/icons/sound2.gif) | [umi] Loreley.opus | 2024-04-08 21:08 | 1.9M | |
![[SND]](/icons/sound2.gif) | [aai2] confrontation ~ allegro.opus | 2021-05-07 12:07 | 1.9M | |
![[SND]](/icons/sound2.gif) | [umi] About face.opus | 2024-04-08 05:29 | 1.9M | |
![[SND]](/icons/sound2.gif) | [gt] chained past.opus | 2021-05-02 09:48 | 1.9M | |
![[SND]](/icons/sound2.gif) | [umi] Activepain.opus | 2024-04-08 05:03 | 1.9M | |
![[SND]](/icons/sound2.gif) | [p4] like a dream come true.opus | 2021-05-02 19:51 | 1.9M | |
![[SND]](/icons/sound2.gif) | [drv3] death road of hope.opus | 2021-04-30 11:36 | 1.9M | |
![[SND]](/icons/sound2.gif) | [p3p] wiping all out.opus | 2021-05-07 21:05 | 1.9M | |
![[SND]](/icons/sound2.gif) | [p4] game.opus | 2021-05-02 19:51 | 1.9M | |
![[SND]](/icons/sound2.gif) | [va-11 hall-a] believe in me who believes in you.opus | 2021-10-04 05:50 | 1.9M | |
![[SND]](/icons/sound2.gif) | [p4] reach out to the truth -first battle-.opus | 2021-05-02 19:52 | 1.9M | |
![[SND]](/icons/sound2.gif) | [aai] objection! ~ miles edgeworth.opus | 2021-05-07 09:29 | 1.9M | |
![[SND]](/icons/sound2.gif) | [p4] castle.opus | 2021-05-02 19:51 | 1.9M | |
![[SND]](/icons/sound2.gif) | [yttd] hirihiri.opus | 2021-08-31 00:03 | 1.9M | |
![[SND]](/icons/sound2.gif) | [dgs] ending.opus | 2020-11-25 20:07 | 1.9M | |
![[SND]](/icons/sound2.gif) | [p5] our beginning.opus | 2021-05-02 21:18 | 1.9M | |
![[SND]](/icons/sound2.gif) | [p4] music of dreams.opus | 2021-05-02 19:52 | 1.9M | |
![[SND]](/icons/sound2.gif) | [UMI] Organ short 200 million in C minor.opus | 2024-04-08 02:50 | 1.9M | |
![[SND]](/icons/sound2.gif) | [dr2] discussion -cross sword-.opus | 2021-04-29 12:40 | 1.9M | |
![[SND]](/icons/sound2.gif) | [gt] dead afterimage.opus | 2021-05-02 09:48 | 1.9M | |
![[SND]](/icons/sound2.gif) | [aa] epilogue.opus | 2021-05-07 07:29 | 1.9M | |
![[SND]](/icons/sound2.gif) | [umi] Monochrome clock.opus | 2024-04-08 05:03 | 1.9M | |
![[SND]](/icons/sound2.gif) | [gt] lynne ~ a targeted redhead.opus | 2021-05-02 09:49 | 1.9M | |
![[SND]](/icons/sound2.gif) | [drv3] sing the empty truth.opus | 2021-04-30 11:38 | 1.9M | |
![[SND]](/icons/sound2.gif) | [drv3] wonderful story.opus | 2021-04-30 11:39 | 1.9M | |
![[SND]](/icons/sound2.gif) | [aai] calisto yew ~ let me laugh at cool.opus | 2021-05-07 09:28 | 1.9M | |
![[SND]](/icons/sound2.gif) | [dkc2] stickerbrush symphony.opus | 2021-08-30 20:59 | 1.9M | |
![[SND]](/icons/sound2.gif) | [p5] desire.opus | 2021-05-02 21:17 | 1.9M | |
![[SND]](/icons/sound2.gif) | [yttd] sin13 (cardiogram third peak).opus | 2021-08-31 00:04 | 1.9M | |
![[SND]](/icons/sound2.gif) | [yttd] yume.opus | 2021-08-31 00:04 | 1.9M | |
![[SND]](/icons/sound2.gif) | [drv3] class trial v3 - resurrection.opus | 2021-04-30 11:35 | 1.9M | |
![[SND]](/icons/sound2.gif) | [p3p] danger zone.opus | 2021-05-02 19:46 | 1.9M | |
![[SND]](/icons/sound2.gif) | [umi] Sakutarous adventure.opus | 2024-04-08 05:19 | 1.9M | |
![[SND]](/icons/sound2.gif) | [p5] confession-secret.opus | 2021-05-02 21:17 | 2.0M | |
![[SND]](/icons/sound2.gif) | [umi] Doorway of summer.opus | 2024-04-07 14:58 | 2.0M | |
![[SND]](/icons/sound2.gif) | [dr1] mr. monokuma after class.opus | 2021-04-29 08:40 | 2.0M | |
![[SND]](/icons/sound2.gif) | [p3p] time.opus | 2021-05-02 19:46 | 2.0M | |
![[SND]](/icons/sound2.gif) | [ut] core.opus | 2021-05-03 12:46 | 2.0M | |
![[SND]](/icons/sound2.gif) | [hk] nightmare king.opus | 2021-05-02 10:21 | 2.0M | |
![[SND]](/icons/sound2.gif) | [p4] i'll face myself -battle-.opus | 2021-05-02 19:51 | 2.0M | |
![[SND]](/icons/sound2.gif) | [ut] battle against a true hero.opus | 2021-05-03 12:46 | 2.0M | |
![[SND]](/icons/sound2.gif) | [umi] Over.opus | 2024-04-08 05:19 | 2.0M | |
![[SND]](/icons/sound2.gif) | [pkmn5] fukiyose city.opus | 2021-05-03 06:25 | 2.0M | |
![[SND]](/icons/sound2.gif) | [caramella girls] caramelldansen (swedish).opus | 2021-05-06 08:35 | 2.0M | |
![[SND]](/icons/sound2.gif) | [HDusk] Big Dreams ~ HD.opus | 2023-07-03 01:03 | 2.0M | |
![[SND]](/icons/sound2.gif) | [p5] jaldabaoth.opus | 2021-05-02 21:17 | 2.0M | |
![[SND]](/icons/sound2.gif) | [umi] String Quartet 1 in G Major.opus | 2024-04-07 15:52 | 2.0M | |
![[SND]](/icons/sound2.gif) | [p5r] out of kindness.opus | 2021-05-03 09:02 | 2.0M | |
![[SND]](/icons/sound2.gif) | [HDusk] Slow Steps ~ HD.opus | 2023-07-03 00:58 | 2.0M | |
![[SND]](/icons/sound2.gif) | [p3] a deep mentality.opus | 2021-06-01 10:24 | 2.0M | |
![[SND]](/icons/sound2.gif) | [gt] suspicion.opus | 2021-05-02 09:49 | 2.0M | |
![[SND]](/icons/sound2.gif) | [dr1] b.t.b. (super final - remix).opus | 2021-04-30 18:19 | 2.0M | |
![[SND]](/icons/sound2.gif) | [aai] confrontation ~ allegro.opus | 2021-05-07 09:28 | 2.0M | |
![[SND]](/icons/sound2.gif) | [p4] backside of the tv.opus | 2021-05-02 19:51 | 2.0M | |
![[SND]](/icons/sound2.gif) | [p5] wake up, get up, get out there -instrumental version-.opus | 2021-05-02 21:19 | 2.0M | |
![[SND]](/icons/sound2.gif) | [HDusk] Sunset Men ~ HD.opus | 2023-07-03 00:46 | 2.0M | |
![[SND]](/icons/sound2.gif) | [p3] joy.opus | 2021-05-02 19:32 | 2.0M | |
![[SND]](/icons/sound2.gif) | [Kirby] Hyness (unhooded).opus | 2024-09-21 00:50 | 2.0M | |
![[SND]](/icons/sound2.gif) | [drv3] heaven of almost hell.opus | 2021-04-30 11:37 | 2.0M | |
![[SND]](/icons/sound2.gif) | [yttd] sin12 (cardiogram rise).opus | 2021-08-31 00:04 | 2.0M | |
![[SND]](/icons/sound2.gif) | [umi] Soul of soul.opus | 2024-04-08 05:03 | 2.1M | |
![[SND]](/icons/sound2.gif) | [dk64] dk rap.opus | 2021-05-01 19:32 | 2.1M | |
![[SND]](/icons/sound2.gif) | [aaaj] lamiroir ~ landscape painter in sound.opus | 2021-05-07 07:37 | 2.1M | |
![[SND]](/icons/sound2.gif) | [HDusk] The Long Night ~ HD.opus | 2023-07-03 01:16 | 2.1M | |
![[SND]](/icons/sound2.gif) | [p5r] gentle madman.opus | 2021-05-03 09:01 | 2.1M | |
![[SND]](/icons/sound2.gif) | [aai2] confrontation ~ moderato.opus | 2021-05-07 12:06 | 2.1M | |
![[SND]](/icons/sound2.gif) | [p5s] what you wish for.opus | 2021-05-03 09:13 | 2.1M | |
![[SND]](/icons/sound2.gif) | [yttd] tansaku4 (exploration e).opus | 2021-08-31 00:05 | 2.1M | |
![[SND]](/icons/sound2.gif) | [p3] troubled.opus | 2021-05-22 20:36 | 2.1M | |
![[SND]](/icons/sound2.gif) | [p5] regret.opus | 2021-05-02 21:18 | 2.1M | |
![[SND]](/icons/sound2.gif) | [umi] Hikari.opus | 2024-04-08 20:53 | 2.1M | |
![[SND]](/icons/sound2.gif) | [Sonic] Flying battery zone.opus | 2024-09-19 08:51 | 2.1M | |
![[SND]](/icons/sound2.gif) | [yttd] otyakai.opus | 2021-08-31 00:04 | 2.1M | |
![[SND]](/icons/sound2.gif) | [umi] Happiness of marionette.opus | 2024-04-08 02:50 | 2.1M | |
![[SND]](/icons/sound2.gif) | [drv3] discussion v3 -break-.opus | 2021-04-30 11:34 | 2.1M | |
![[SND]](/icons/sound2.gif) | [ut] hopes and dreams.opus | 2021-05-03 12:47 | 2.1M | |
![[SND]](/icons/sound2.gif) | [p4au] yukari takeba - pink sniper.opus | 2021-11-27 14:36 | 2.1M | |
![[SND]](/icons/sound2.gif) | [gt] a dashing enigma.opus | 2021-05-02 09:48 | 2.1M | |
![[SND]](/icons/sound2.gif) | [aai] confrontation ~ presto.opus | 2021-05-07 09:28 | 2.1M | |
![[SND]](/icons/sound2.gif) | [p4] your affection.opus | 2021-05-02 19:53 | 2.1M | |
![[SND]](/icons/sound2.gif) | [ut] it's raining somewhere else.opus | 2021-05-03 12:47 | 2.1M | |
![[SND]](/icons/sound2.gif) | [yttd] clown's song (cover).opus | 2021-05-07 20:15 | 2.1M | |
![[SND]](/icons/sound2.gif) | [umi] Toy Box.opus | 2024-04-08 21:24 | 2.1M | |
![[SND]](/icons/sound2.gif) | [celeste] awake.opus | 2021-05-01 19:12 | 2.1M | |
![[SND]](/icons/sound2.gif) | [aat&t] elise deauxnim ~ gentle melody.opus | 2021-05-21 07:46 | 2.1M | |
![[SND]](/icons/sound2.gif) | [HDusk] The Last Sleep ~ HD.opus | 2023-07-03 01:03 | 2.1M | |
![[SND]](/icons/sound2.gif) | [p5r] mementos -upper layer-.opus | 2021-05-03 09:01 | 2.1M | |
![[SND]](/icons/sound2.gif) | [p4] i'll face myself.opus | 2021-05-02 19:51 | 2.1M | |
![[SND]](/icons/sound2.gif) | [yttd] ankokugai.opus | 2021-08-31 00:03 | 2.1M | |
![[SND]](/icons/sound2.gif) | [999] imaginary.opus | 2021-05-02 14:13 | 2.1M | |
![[SND]](/icons/sound2.gif) | [aa] maya fey ~ turnabout sisters.opus | 2021-05-07 07:29 | 2.1M | |
![[SND]](/icons/sound2.gif) | [p4au] rise kujikawa - twinkle☆star.opus | 2021-05-02 21:02 | 2.1M | |
![[SND]](/icons/sound2.gif) | [p4] signs of love.opus | 2021-05-02 19:52 | 2.1M | |
![[SND]](/icons/sound2.gif) | [aai2] objection! ~ miles edgeworth.opus | 2021-05-07 12:08 | 2.1M | |
![[SND]](/icons/sound2.gif) | [yttd] nounai.opus | 2021-08-31 00:04 | 2.1M | |
![[SND]](/icons/sound2.gif) | [HDusk] Serenity ~ HD.opus | 2023-07-03 01:13 | 2.1M | |
![[SND]](/icons/sound2.gif) | [dr1] underground trial (instrumental mix).opus | 2021-04-30 18:19 | 2.1M | |
![[SND]](/icons/sound2.gif) | [HDusk] Hitting the Pavement ~ HD.opus | 2023-07-03 01:14 | 2.1M | |
![[SND]](/icons/sound2.gif) | [m2] sanctuary guardian.opus | 2021-05-02 14:02 | 2.1M | |
![[SND]](/icons/sound2.gif) | [p5r] mementos -under layer-.opus | 2021-05-03 09:01 | 2.1M | |
![[SND]](/icons/sound2.gif) | [dr] field of hopes and dreams.opus | 2021-05-01 19:28 | 2.2M | |
![[SND]](/icons/sound2.gif) | [yttd] kosatu.opus | 2021-08-31 00:03 | 2.2M | |
![[SND]](/icons/sound2.gif) | [p5s] axe to grind.opus | 2021-05-03 09:12 | 2.2M | |
![[SND]](/icons/sound2.gif) | [umi] Mother.opus | 2024-04-08 02:50 | 2.2M | |
![[SND]](/icons/sound2.gif) | [drudg] the warriors of hope.opus | 2021-04-30 14:12 | 2.2M | |
![[SND]](/icons/sound2.gif) | [aai] pursuit.opus | 2021-05-07 09:29 | 2.2M | |
![[SND]](/icons/sound2.gif) | [aai2] logic chess ~ opening.opus | 2021-05-07 12:08 | 2.2M | |
![[SND]](/icons/sound2.gif) | [yttd] coolpiano.opus | 2021-08-31 00:03 | 2.2M | |
![[SND]](/icons/sound2.gif) | [s1] splattack!.opus | 2021-05-04 16:44 | 2.2M | |
![[SND]](/icons/sound2.gif) | [aai2] logic chess ~ endgame.opus | 2021-05-07 12:07 | 2.2M | |
![[SND]](/icons/sound2.gif) | [umi] Play.opus | 2024-04-08 02:45 | 2.2M | |
![[SND]](/icons/sound2.gif) | [umi] Aci-L.opus | 2024-04-08 16:38 | 2.2M | |
![[SND]](/icons/sound2.gif) | [p3fes] mass destruction.opus | 2021-05-02 19:41 | 2.2M | |
![[SND]](/icons/sound2.gif) | [gt] providence.opus | 2021-05-02 09:49 | 2.2M | |
![[SND]](/icons/sound2.gif) | [999] foreboding.opus | 2021-05-02 14:13 | 2.2M | |
![[SND]](/icons/sound2.gif) | [gt] saying goodbye.opus | 2021-05-02 09:49 | 2.2M | |
![[SND]](/icons/sound2.gif) | [999] tranquility.opus | 2021-05-02 14:14 | 2.2M | |
![[SND]](/icons/sound2.gif) | [p5r] take over.opus | 2021-05-03 09:02 | 2.2M | |
![[SND]](/icons/sound2.gif) | [drv3] a.a. (final, hyper).opus | 2021-04-30 11:34 | 2.2M | |
![[SND]](/icons/sound2.gif) | [dr] chaos king (lyrics).opus | 2021-05-07 17:12 | 2.2M | |
![[SND]](/icons/sound2.gif) | [p4a] aigis - heartful cry.opus | 2021-05-02 21:02 | 2.2M | |
![[SND]](/icons/sound2.gif) | [HDusk] Violet Sky ~ HD.opus | 2023-07-03 00:45 | 2.2M | |
![[SND]](/icons/sound2.gif) | [dr2] tropical despair.opus | 2021-04-29 12:39 | 2.2M | |
![[SND]](/icons/sound2.gif) | [dr2] dive drive.opus | 2021-04-29 12:40 | 2.2M | |
![[SND]](/icons/sound2.gif) | [umi] Witch of the painting.opus | 2024-04-08 02:45 | 2.2M | |
![[SND]](/icons/sound2.gif) | [p3] master of tartarus.opus | 2021-05-22 20:36 | 2.2M | |
![[SND]](/icons/sound2.gif) | [yttd] hazama1.opus | 2021-08-31 00:03 | 2.2M | |
![[SND]](/icons/sound2.gif) | [HDusk] Midnight ~ HD.opus | 2023-07-03 01:01 | 2.2M | |
![[SND]](/icons/sound2.gif) | [aai2] justine courtney ~ goddess of law.opus | 2021-05-07 12:07 | 2.2M | |
![[SND]](/icons/sound2.gif) | [umi] Surrounding.opus | 2024-04-08 05:19 | 2.2M | |
![[SND]](/icons/sound2.gif) | [p3fes] darkness.opus | 2021-05-02 19:41 | 2.2M | |
![[SND]](/icons/sound2.gif) | [yttd] tunagu (connecting, together a).opus | 2021-08-31 00:06 | 2.2M | |
![[SND]](/icons/sound2.gif) | [HDusk] Insomnia ~ HD.opus | 2023-07-03 00:52 | 2.2M | |
![[SND]](/icons/sound2.gif) | [umi] Hibuta.opus | 2024-04-08 05:29 | 2.2M | |
![[SND]](/icons/sound2.gif) | [aa] logic and tricks.opus | 2021-05-07 07:29 | 2.2M | |
![[SND]](/icons/sound2.gif) | [dr1] distrust.opus | 2021-04-29 08:40 | 2.2M | |
![[SND]](/icons/sound2.gif) | [p5] the whims of fate.opus | 2021-05-02 21:19 | 2.2M | |
![[SND]](/icons/sound2.gif) | [umi] Waltz Op. 34.opus | 2024-04-08 21:01 | 2.2M | |
![[SND]](/icons/sound2.gif) | [p4au] margaret - poem for everyone's souls.opus | 2021-05-02 21:02 | 2.2M | |
![[SND]](/icons/sound2.gif) | [p4] heaven.opus | 2021-05-02 19:51 | 2.3M | |
![[SND]](/icons/sound2.gif) | [umi] Lifes end.opus | 2024-04-08 02:45 | 2.3M | |
![[SND]](/icons/sound2.gif) | [dr2] discussion -b-side-.opus | 2021-04-29 12:41 | 2.3M | |
![[SND]](/icons/sound2.gif) | [umi] Soar Hishou.opus | 2024-04-08 21:44 | 2.3M | |
![[SND]](/icons/sound2.gif) | [p3dmn] our moment.opus | 2021-05-03 09:17 | 2.3M | |
![[SND]](/icons/sound2.gif) | [yttd] yuukinoasi (step of courage).opus | 2021-08-31 00:04 | 2.3M | |
![[SND]](/icons/sound2.gif) | [hk] fungal wastes.opus | 2021-05-02 10:21 | 2.3M | |
![[SND]](/icons/sound2.gif) | [p4a] yosuke hanamura - the junes hero.opus | 2021-05-02 21:02 | 2.3M | |
![[SND]](/icons/sound2.gif) | [999] binary game.opus | 2021-05-02 14:13 | 2.3M | |
![[SND]](/icons/sound2.gif) | [drv3] discussion v3 -hope vs despair-.opus | 2021-04-30 11:35 | 2.3M | |
![[SND]](/icons/sound2.gif) | [aai] confrontation ~ moderato.opus | 2021-05-07 09:28 | 2.3M | |
![[SND]](/icons/sound2.gif) | [celeste] madeline and theo.opus | 2021-05-01 19:12 | 2.3M | |
![[SND]](/icons/sound2.gif) | [umi] Eternity.opus | 2024-04-08 05:19 | 2.3M | |
![[SND]](/icons/sound2.gif) | [umi] Bread of life.opus | 2024-04-08 20:53 | 2.3M | |
![[SND]](/icons/sound2.gif) | [pkmn1] last battle (vs rival).opus | 2021-05-03 06:21 | 2.3M | |
![[SND]](/icons/sound2.gif) | [hk] city of tears.opus | 2021-05-02 10:21 | 2.3M | |
![[SND]](/icons/sound2.gif) | [p5] swear to my bones.opus | 2021-05-02 21:18 | 2.3M | |
![[SND]](/icons/sound2.gif) | [f-777] deadlocked.opus | 2021-05-06 08:37 | 2.4M | |
![[SND]](/icons/sound2.gif) | [dr2] discussion -heat up- (2nd mix).opus | 2021-04-29 12:40 | 2.4M | |
![[SND]](/icons/sound2.gif) | [umi] Wings.opus | 2024-04-08 05:03 | 2.4M | |
![[SND]](/icons/sound2.gif) | [umi] Red dread.opus | 2024-04-08 02:45 | 2.4M | |
![[SND]](/icons/sound2.gif) | [gt] jowd ~ a captive of fate.opus | 2021-05-02 09:48 | 2.4M | |
![[SND]](/icons/sound2.gif) | [yttd] denpa.opus | 2021-08-31 00:03 | 2.4M | |
![[SND]](/icons/sound2.gif) | [p3] mass destruction.opus | 2021-05-02 19:32 | 2.4M | |
![[SND]](/icons/sound2.gif) | [aat&t] hazakura temple.opus | 2021-05-21 07:46 | 2.4M | |
![[SND]](/icons/sound2.gif) | [yttd] horror-ginen.opus | 2021-05-04 10:51 | 2.4M | |
![[SND]](/icons/sound2.gif) | [drv3] new classmates of the dead.opus | 2021-04-30 11:38 | 2.4M | |
![[SND]](/icons/sound2.gif) | [celeste] forsaken city (sever the skyline mix).opus | 2021-05-01 19:12 | 2.4M | |
![[SND]](/icons/sound2.gif) | [yttd] tunagu2 (connecting, together b).opus | 2021-08-31 00:04 | 2.4M | |
![[SND]](/icons/sound2.gif) | [umi] Rog limitation.opus | 2024-04-08 21:01 | 2.4M | |
![[SND]](/icons/sound2.gif) | [p3] burn my dread (full).opus | 2021-05-02 19:32 | 2.4M | |
![[SND]](/icons/sound2.gif) | [drv3] death road of despair.opus | 2021-04-30 11:36 | 2.4M | |
![[SND]](/icons/sound2.gif) | [dr1] despair syndrome (1).opus | 2021-04-29 08:40 | 2.4M | |
![[SND]](/icons/sound2.gif) | [ahit] mafia boss' big showdown.opus | 2021-05-01 17:18 | 2.4M | |
![[SND]](/icons/sound2.gif) | [999] extreme extrication.opus | 2021-05-02 14:13 | 2.4M | |
![[SND]](/icons/sound2.gif) | [p5] new beginning.opus | 2021-05-02 21:18 | 2.4M | |
![[SND]](/icons/sound2.gif) | [yttd] klkl.opus | 2021-05-04 10:52 | 2.4M | |
![[SND]](/icons/sound2.gif) | [p5] nothingness....opus | 2021-05-02 21:18 | 2.4M | |
![[SND]](/icons/sound2.gif) | [999] tinderbox.opus | 2021-05-02 14:14 | 2.4M | |
![[SND]](/icons/sound2.gif) | [pkmn5] decisive battle! n.opus | 2021-05-03 06:25 | 2.4M | |
![[SND]](/icons/sound2.gif) | [Sonic Heroes] What I'm made of.opus | 2024-09-19 08:52 | 2.4M | |
![[SND]](/icons/sound2.gif) | [umi] Engage of marionette.opus | 2024-04-08 21:08 | 2.4M | |
![[SND]](/icons/sound2.gif) | [drv3] psyche taxi.opus | 2021-04-30 11:38 | 2.4M | |
![[SND]](/icons/sound2.gif) | [Sonic] I am all of me.opus | 2024-09-22 18:33 | 2.5M | |
![[SND]](/icons/sound2.gif) | [umi] The candles dance.opus | 2024-04-08 02:32 | 2.5M | |
![[SND]](/icons/sound2.gif) | [yttd] kessen.opus | 2021-05-04 10:52 | 2.5M | |
![[SND]](/icons/sound2.gif) | [umi] Birth of new witch.opus | 2024-04-08 21:16 | 2.5M | |
![[SND]](/icons/sound2.gif) | [umi] Dance of the moon rabbits.opus | 2024-04-08 02:50 | 2.5M | |
![[SND]](/icons/sound2.gif) | [dr2] discussion -hope vs despair- (2nd mix).opus | 2021-04-29 12:40 | 2.5M | |
![[SND]](/icons/sound2.gif) | [dgs] closing suite.opus | 2020-11-25 20:07 | 2.5M | |
![[SND]](/icons/sound2.gif) | [umi] Scar sound.opus | 2024-04-07 15:23 | 2.5M | |
![[SND]](/icons/sound2.gif) | [umi] Blue Butterfly.opus | 2024-04-08 21:01 | 2.5M | |
![[SND]](/icons/sound2.gif) | [umi] Praise.opus | 2024-04-07 15:23 | 2.5M | |
![[SND]](/icons/sound2.gif) | [umi] Life.opus | 2024-04-08 21:08 | 2.5M | |
![[SND]](/icons/sound2.gif) | [HDusk] Limits of Doubt ~ HD.opus | 2023-07-03 00:54 | 2.5M | |
![[SND]](/icons/sound2.gif) | [p4] reasoning.opus | 2021-05-02 19:52 | 2.5M | |
![[SND]](/icons/sound2.gif) | [umi] Happy Maria.opus | 2024-04-08 05:29 | 2.5M | |
![[SND]](/icons/sound2.gif) | [ff7] one winged angel.opus | 2021-08-30 21:00 | 2.5M | |
![[SND]](/icons/sound2.gif) | [p4d] dance!.opus | 2021-05-03 09:17 | 2.5M | |
![[SND]](/icons/sound2.gif) | [celeste] little goth.opus | 2021-05-01 19:12 | 2.5M | |
![[SND]](/icons/sound2.gif) | [umi] Look Back.opus | 2024-04-08 21:01 | 2.5M | |
![[SND]](/icons/sound2.gif) | [umi] Requiem.opus | 2024-04-07 15:38 | 2.5M | |
![[SND]](/icons/sound2.gif) | [drv3] cool morning.opus | 2021-04-30 11:36 | 2.5M | |
![[SND]](/icons/sound2.gif) | [umi] Closed my heart.opus | 2024-04-07 15:38 | 2.6M | |
![[SND]](/icons/sound2.gif) | [dr1] despair syndrome (2).opus | 2021-04-29 08:40 | 2.6M | |
![[SND]](/icons/sound2.gif) | [p3] burn my dread -last battle-.opus | 2021-05-02 19:32 | 2.6M | |
![[SND]](/icons/sound2.gif) | [p4] smile.opus | 2021-05-02 19:52 | 2.6M | |
![[SND]](/icons/sound2.gif) | [p5s] keeper of lust -scramble-.opus | 2021-05-03 09:13 | 2.6M | |
![[SND]](/icons/sound2.gif) | [umi] Mystic forest.opus | 2024-04-08 05:19 | 2.6M | |
![[SND]](/icons/sound2.gif) | [p4g] snowflakes.opus | 2021-05-02 21:10 | 2.6M | |
![[SND]](/icons/sound2.gif) | [dr1] welcome to despair.opus | 2021-04-29 08:41 | 2.6M | |
![[SND]](/icons/sound2.gif) | [umi] Discode.opus | 2024-04-08 05:29 | 2.6M | |
![[SND]](/icons/sound2.gif) | [p5r] keep your faith.opus | 2021-05-03 09:01 | 2.6M | |
![[SND]](/icons/sound2.gif) | [umi] Witch in gold (cembalo).opus | 2024-04-08 02:45 | 2.6M | |
![[SND]](/icons/sound2.gif) | [umi] Ricordando il passato.opus | 2024-04-08 21:44 | 2.6M | |
![[SND]](/icons/sound2.gif) | [ut] your best nightmare.opus | 2021-05-03 12:47 | 2.6M | |
![[SND]](/icons/sound2.gif) | [dr1] beautiful morning.opus | 2021-04-29 08:39 | 2.6M | |
![[SND]](/icons/sound2.gif) | [dr] a cyber's world.opus | 2023-01-15 18:41 | 2.6M | |
![[SND]](/icons/sound2.gif) | [aai2] lamenting people.opus | 2023-09-05 07:48 | 2.7M | |
![[SND]](/icons/sound2.gif) | [pkmn5] souryuu city (white).opus | 2021-05-03 06:25 | 2.7M | |
![[SND]](/icons/sound2.gif) | [dr1] mr. monokuma's lesson.opus | 2021-04-29 08:40 | 2.7M | |
![[SND]](/icons/sound2.gif) | [p4] fog.opus | 2021-05-02 19:51 | 2.7M | |
![[SND]](/icons/sound2.gif) | [umi] Rebirth.opus | 2024-04-08 21:16 | 2.7M | |
![[SND]](/icons/sound2.gif) | [ahit] your contract has expired.opus | 2021-05-01 17:19 | 2.7M | |
![[SND]](/icons/sound2.gif) | [umi] F style.opus | 2024-04-08 05:19 | 2.7M | |
![[SND]](/icons/sound2.gif) | [umi] Thanks for all people.opus | 2024-04-08 21:16 | 2.7M | |
![[SND]](/icons/sound2.gif) | [Sonic] Endless Possibility.opus | 2024-09-29 14:32 | 2.7M | |
![[SND]](/icons/sound2.gif) | [p3] blues in velvet room.opus | 2021-05-02 19:32 | 2.7M | |
![[SND]](/icons/sound2.gif) | [p5] keeper of lust.opus | 2021-05-02 21:17 | 2.7M | |
![[SND]](/icons/sound2.gif) | [p5r] throw away your mask.opus | 2021-05-03 09:02 | 2.7M | |
![[SND]](/icons/sound2.gif) | [umi] Pathway.opus | 2024-04-08 21:16 | 2.7M | |
![[SND]](/icons/sound2.gif) | [umi] Moon.opus | 2024-04-08 02:19 | 2.7M | |
![[SND]](/icons/sound2.gif) | [Helltaker] Mittsies - Vitality.opus | 2024-09-27 22:05 | 2.7M | |
![[SND]](/icons/sound2.gif) | [umi] Happy Maria(instrumental).opus | 2024-04-08 05:19 | 2.7M | |
![[SND]](/icons/sound2.gif) | [p5r] lets go! featherman!.opus | 2021-05-03 09:01 | 2.7M | |
![[SND]](/icons/sound2.gif) | [p3] self redemption.opus | 2021-05-06 11:07 | 2.7M | |
![[SND]](/icons/sound2.gif) | [umi] Ride on.opus | 2024-04-07 14:58 | 2.7M | |
![[SND]](/icons/sound2.gif) | [umi] Song without a name.opus | 2024-04-08 21:33 | 2.7M | |
![[SND]](/icons/sound2.gif) | [dr1] discussion -break-.opus | 2021-04-29 08:41 | 2.7M | |
![[SND]](/icons/sound2.gif) | [UMI] Corridor - sands of purgatory.opus | 2024-04-08 02:45 | 2.8M | |
![[SND]](/icons/sound2.gif) | [p5r] so happy world.opus | 2021-05-03 09:02 | 2.8M | |
![[SND]](/icons/sound2.gif) | [p5] last surprise.opus | 2021-05-02 21:17 | 2.8M | |
![[SND]](/icons/sound2.gif) | [umi] Fishy Aroma (vocals).opus | 2024-04-08 21:16 | 2.8M | |
![[SND]](/icons/sound2.gif) | [yttd] dance.opus | 2021-05-04 10:50 | 2.8M | |
![[SND]](/icons/sound2.gif) | [drv3] class trial v3 - resurrection (with intro).opus | 2021-04-30 11:35 | 2.8M | |
![[SND]](/icons/sound2.gif) | [umi] Nighteyes.opus | 2024-04-07 15:38 | 2.8M | |
![[SND]](/icons/sound2.gif) | [ahit] title screen.opus | 2021-05-01 17:18 | 2.8M | |
![[SND]](/icons/sound2.gif) | [drv3] new world order v3.opus | 2021-04-30 11:38 | 2.8M | |
![[SND]](/icons/sound2.gif) | [p5] blooming villain.opus | 2021-05-02 21:16 | 2.8M | |
![[SND]](/icons/sound2.gif) | [p3fes] heartful cry.opus | 2021-05-02 19:41 | 2.8M | |
![[SND]](/icons/sound2.gif) | [dr1] class trial - chaos.opus | 2021-04-29 08:40 | 2.8M | |
![[SND]](/icons/sound2.gif) | [drv3] nightmare in the locker.opus | 2021-04-30 11:38 | 2.8M | |
![[SND]](/icons/sound2.gif) | [dr2] class trial - chaos (vol. 2).opus | 2021-04-29 12:39 | 2.8M | |
![[SND]](/icons/sound2.gif) | [umi] Melting away.opus | 2024-04-08 02:50 | 2.8M | |
![[SND]](/icons/sound2.gif) | [p5s] last surprise -scramble-.opus | 2021-05-03 09:12 | 2.8M | |
![[SND]](/icons/sound2.gif) | [dr2] beautiful ruin (summer salt).opus | 2021-04-29 12:39 | 2.8M | |
![[SND]](/icons/sound2.gif) | [dr1] closing argument.opus | 2021-04-29 08:40 | 2.8M | |
![[SND]](/icons/sound2.gif) | [drv3] a.a. - ch. 1 (new, hyper).opus | 2021-04-30 11:34 | 2.8M | |
![[SND]](/icons/sound2.gif) | [umi] Future.opus | 2024-04-08 16:29 | 2.8M | |
![[SND]](/icons/sound2.gif) | [umi] Love examination.opus | 2024-04-08 21:01 | 2.8M | |
![[SND]](/icons/sound2.gif) | [drv3] a.a. (final).opus | 2021-04-30 11:34 | 2.8M | |
![[SND]](/icons/sound2.gif) | [p5s] you are stronger.opus | 2021-05-03 09:13 | 2.8M | |
![[SND]](/icons/sound2.gif) | [initial d] gas gas gas.opus | 2021-05-06 08:05 | 2.8M | |
![[SND]](/icons/sound2.gif) | [Terraria] Calamity mod music - The filthy mind.opus | 2024-09-20 07:25 | 2.8M | |
![[SND]](/icons/sound2.gif) | [p5r] mementos -middle layer-.opus | 2021-05-03 09:01 | 2.8M | |
![[SND]](/icons/sound2.gif) | [umi] Revolt.opus | 2024-04-08 05:29 | 2.8M | |
![[SND]](/icons/sound2.gif) | [celeste] celestial resort (good karma mix).opus | 2021-05-01 19:12 | 2.8M | |
![[SND]](/icons/sound2.gif) | [HDusk] Countdown ~ HD.opus | 2023-07-03 01:10 | 2.9M | |
![[SND]](/icons/sound2.gif) | [dr1] discussion -heat up-.opus | 2021-04-29 08:41 | 2.9M | |
![[SND]](/icons/sound2.gif) | [umi] Hope.opus | 2024-04-07 14:58 | 2.9M | |
![[SND]](/icons/sound2.gif) | [Everhood] Revenge.opus | 2024-09-19 08:58 | 2.9M | |
![[SND]](/icons/sound2.gif) | [umi] Prison.opus | 2024-04-08 05:03 | 2.9M | |
![[SND]](/icons/sound2.gif) | [dr2] discussion -break- (2nd mix).opus | 2021-04-29 12:39 | 2.9M | |
![[SND]](/icons/sound2.gif) | [touhou] tonight stars an easygoing egoist (live ver).opus | 2022-12-28 13:47 | 2.9M | |
![[SND]](/icons/sound2.gif) | [touhou] love-colored master spark.opus | 2022-12-28 13:50 | 2.9M | |
![[SND]](/icons/sound2.gif) | [umi] Grey Empty Smile.opus | 2024-04-08 20:53 | 2.9M | |
![[SND]](/icons/sound2.gif) | [p5] the days when my mother was there.opus | 2021-05-02 21:19 | 2.9M | |
![[SND]](/icons/sound2.gif) | [umi] Spiral.opus | 2024-04-08 16:29 | 2.9M | |
![[SND]](/icons/sound2.gif) | [dr1] box 15.opus | 2021-04-29 08:39 | 2.9M | |
![[SND]](/icons/sound2.gif) | [drv3] living in a lazy parallel world.opus | 2021-04-30 11:37 | 2.9M | |
![[SND]](/icons/sound2.gif) | [Terraria] Calamity mod music - Universal collapse.opus | 2024-09-20 07:26 | 2.9M | |
![[SND]](/icons/sound2.gif) | [umi] At deaths door.opus | 2024-04-07 15:05 | 2.9M | |
![[SND]](/icons/sound2.gif) | [p5] freedom and security.opus | 2021-05-02 21:17 | 2.9M | |
![[SND]](/icons/sound2.gif) | [p5r] royal days.opus | 2021-05-03 09:02 | 2.9M | |
![[SND]](/icons/sound2.gif) | [dr1] death wish.opus | 2021-04-29 08:40 | 2.9M | |
![[SND]](/icons/sound2.gif) | [umi] Thanks for being born.opus | 2024-04-08 05:03 | 2.9M | |
![[SND]](/icons/sound2.gif) | [celeste] mirror temple (mirror magic mix).opus | 2021-05-01 19:13 | 2.9M | |
![[SND]](/icons/sound2.gif) | [celeste] confronting myself.opus | 2021-05-01 19:12 | 3.0M | |
![[SND]](/icons/sound2.gif) | [999] chill and rigor.opus | 2021-05-02 14:12 | 3.0M | |
![[SND]](/icons/sound2.gif) | [umi] The first and the last.opus | 2024-04-08 21:08 | 3.0M | |
![[SND]](/icons/sound2.gif) | [drv3] rise of the ultimates.opus | 2021-04-30 11:38 | 3.0M | |
![[SND]](/icons/sound2.gif) | [999] quaternary game.opus | 2021-05-02 14:13 | 3.0M | |
![[SND]](/icons/sound2.gif) | [umi] Haruka.opus | 2024-04-08 02:45 | 3.0M | |
![[SND]](/icons/sound2.gif) | [p4] a new world fool.opus | 2021-05-02 19:51 | 3.0M | |
![[SND]](/icons/sound2.gif) | [sonic'06] his world.opus | 2021-05-04 08:45 | 3.0M | |
![[SND]](/icons/sound2.gif) | [p5] life will change.opus | 2021-05-02 21:18 | 3.0M | |
![[SND]](/icons/sound2.gif) | [HDusk] Endless Road ~ HD.opus | 2023-07-03 01:05 | 3.0M | |
![[SND]](/icons/sound2.gif) | [p5r] i believe.opus | 2021-05-03 09:01 | 3.0M | |
![[SND]](/icons/sound2.gif) | [drv3] class trial v3 - the sun (ver.b).opus | 2021-04-30 11:36 | 3.0M | |
![[SND]](/icons/sound2.gif) | [HDusk] Resolution ~ HD.opus | 2023-07-03 00:53 | 3.0M | |
![[SND]](/icons/sound2.gif) | [Sonic] Live and learn.opus | 2024-09-29 14:28 | 3.0M | |
![[SND]](/icons/sound2.gif) | [umi] Final answer.opus | 2024-04-08 20:53 | 3.0M | |
![[SND]](/icons/sound2.gif) | [umi] System Zero.opus | 2024-04-07 15:52 | 3.0M | |
![[SND]](/icons/sound2.gif) | [999] nonary game.opus | 2021-05-02 14:13 | 3.0M | |
![[SND]](/icons/sound2.gif) | [p5r] no more what ifs.opus | 2021-05-03 09:02 | 3.0M | |
![[SND]](/icons/sound2.gif) | [umi] Far.opus | 2024-04-08 02:32 | 3.0M | |
![[SND]](/icons/sound2.gif) | [yttd] sin10 (cardiogram climax).opus | 2021-05-04 10:53 | 3.0M | |
![[SND]](/icons/sound2.gif) | [hk] greenpath.opus | 2021-05-02 10:21 | 3.0M | |
![[SND]](/icons/sound2.gif) | [touhou] flowering night.opus | 2022-12-28 13:56 | 3.0M | |
![[SND]](/icons/sound2.gif) | [umi] Tomorrow.opus | 2024-04-08 20:53 | 3.0M | |
![[SND]](/icons/sound2.gif) | [umi] As time goes by.opus | 2024-04-08 02:45 | 3.0M | |
![[SND]](/icons/sound2.gif) | [dgs2] closing suite.opus | 2020-11-25 20:07 | 3.0M | |
![[SND]](/icons/sound2.gif) | [camellia] nasty nasty spell.opus | 2021-05-06 08:35 | 3.1M | |
![[SND]](/icons/sound2.gif) | [initial d] running in the 90's.opus | 2021-05-06 08:05 | 3.1M | |
![[SND]](/icons/sound2.gif) | [umi] In the sun.opus | 2024-04-08 02:32 | 3.1M | |
![[SND]](/icons/sound2.gif) | [p5] alleycat.opus | 2021-05-02 21:16 | 3.1M | |
![[SND]](/icons/sound2.gif) | [999] senary game.opus | 2021-05-02 14:13 | 3.1M | |
![[SND]](/icons/sound2.gif) | [umi] Smile-less soiree.opus | 2024-04-08 16:29 | 3.1M | |
![[SND]](/icons/sound2.gif) | [drv3] beautiful lie.opus | 2021-04-30 11:35 | 3.1M | |
![[SND]](/icons/sound2.gif) | [999] quietus.opus | 2021-05-02 14:13 | 3.1M | |
![[SND]](/icons/sound2.gif) | [drv3] exisal tribe.opus | 2021-04-30 11:37 | 3.1M | |
![[SND]](/icons/sound2.gif) | [999] who is zero.opus | 2021-05-02 14:14 | 3.1M | |
![[SND]](/icons/sound2.gif) | [p5] wake up, get up, get out there.opus | 2021-05-02 21:19 | 3.2M | |
![[SND]](/icons/sound2.gif) | [yttd] cardiogram intense.opus | 2021-05-04 10:50 | 3.2M | |
![[SND]](/icons/sound2.gif) | [aai] miles edgeworth ~ great revival.opus | 2021-05-07 09:29 | 3.2M | |
![[SND]](/icons/sound2.gif) | [umi] Fishy aroma.opus | 2024-04-07 15:23 | 3.2M | |
![[SND]](/icons/sound2.gif) | [umi] Far (piano version).opus | 2024-04-08 21:24 | 3.2M | |
![[SND]](/icons/sound2.gif) | [umi] One.opus | 2024-04-08 16:29 | 3.2M | |
![[SND]](/icons/sound2.gif) | [dr1] new world order.opus | 2021-04-29 08:41 | 3.2M | |
![[SND]](/icons/sound2.gif) | [umi] Promise.opus | 2024-04-08 20:53 | 3.2M | |
![[SND]](/icons/sound2.gif) | [999] trepidation.opus | 2021-05-02 14:14 | 3.2M | |
![[SND]](/icons/sound2.gif) | [p3p] soul phrase (full).opus | 2021-05-02 19:46 | 3.2M | |
![[SND]](/icons/sound2.gif) | [umi] The dark and crazed requiem of purgatory.opus | 2024-04-08 05:29 | 3.2M | |
![[SND]](/icons/sound2.gif) | [drv3] despair searching.opus | 2021-04-30 11:37 | 3.2M | |
![[SND]](/icons/sound2.gif) | [umi] Moonlit night.opus | 2024-04-07 15:05 | 3.2M | |
![[SND]](/icons/sound2.gif) | [p4] the almighty.opus | 2021-05-02 19:52 | 3.3M | |
![[SND]](/icons/sound2.gif) | [yttd] sin11 (rythme cardiogram).opus | 2021-05-04 10:53 | 3.3M | |
![[SND]](/icons/sound2.gif) | [999] digital root.opus | 2021-05-02 14:12 | 3.3M | |
![[SND]](/icons/sound2.gif) | [umi] Ridicule.opus | 2024-04-08 21:32 | 3.3M | |
![[SND]](/icons/sound2.gif) | [umi] Stuffed Animal.opus | 2024-04-08 21:44 | 3.3M | |
![[SND]](/icons/sound2.gif) | [HDusk] Dead Stare ~ HD.opus | 2023-07-03 01:01 | 3.3M | |
![[SND]](/icons/sound2.gif) | [umi] Dread of the grave -rhythm version-.opus | 2024-04-08 05:03 | 3.3M | |
![[SND]](/icons/sound2.gif) | [drv3] scrum debate.opus | 2021-04-30 11:35 | 3.3M | |
![[SND]](/icons/sound2.gif) | [drv3] discussion v3 -blade lock-.opus | 2021-04-30 11:34 | 3.3M | |
![[SND]](/icons/sound2.gif) | [umi] Worldend (solo).opus | 2024-04-08 02:45 | 3.3M | |
![[SND]](/icons/sound2.gif) | [mgrr] it has to be this way.opus | 2022-05-27 14:37 | 3.3M | |
![[SND]](/icons/sound2.gif) | [yttd] seme-ks-zn.opus | 2021-05-04 10:53 | 3.3M | |
![[SND]](/icons/sound2.gif) | [yttd] reason it out b.opus | 2021-05-04 10:52 | 3.3M | |
![[SND]](/icons/sound2.gif) | [UMI] Intellectual Rapist.opus | 2024-09-29 14:32 | 3.3M | |
![[SND]](/icons/sound2.gif) | [umi] Intellectual Rapist ver-C.opus | 2024-09-12 00:21 | 3.3M | |
![[SND]](/icons/sound2.gif) | [dr1] beautiful days.opus | 2021-04-29 08:41 | 3.3M | |
![[SND]](/icons/sound2.gif) | [drv3] real - fiction.opus | 2021-04-30 11:38 | 3.3M | |
![[SND]](/icons/sound2.gif) | [p5r] mementos -new layer-.opus | 2021-05-03 09:01 | 3.3M | |
![[SND]](/icons/sound2.gif) | [yttd] aren't you cheerful.opus | 2021-05-04 10:50 | 3.3M | |
![[SND]](/icons/sound2.gif) | [Terraria] Calamity mod music - Infestation.opus | 2024-09-19 08:49 | 3.3M | |
![[SND]](/icons/sound2.gif) | [ahit] the big parade.opus | 2021-05-01 17:18 | 3.4M | |
![[SND]](/icons/sound2.gif) | [p5s] daredevil.opus | 2021-05-03 09:13 | 3.4M | |
![[SND]](/icons/sound2.gif) | [umi] Hello your dream.opus | 2024-04-08 16:38 | 3.4M | |
![[SND]](/icons/sound2.gif) | [Initial D] Night of fire.opus | 2024-09-19 08:57 | 3.4M | |
![[SND]](/icons/sound2.gif) | [DKCTP] Big top bop.opus | 2024-09-19 08:53 | 3.4M | |
![[SND]](/icons/sound2.gif) | [touhou] bad apple (2007).opus | 2021-05-03 18:33 | 3.4M | |
![[SND]](/icons/sound2.gif) | [drv3] becoming friends.opus | 2021-04-30 11:35 | 3.4M | |
![[SND]](/icons/sound2.gif) | [999] riddle and puzzle.opus | 2021-05-02 14:13 | 3.4M | |
![[SND]](/icons/sound2.gif) | [dr1] discussion -hope vs despair-.opus | 2021-04-29 08:41 | 3.4M | |
![[SND]](/icons/sound2.gif) | [yttd] zetsubou.opus | 2021-05-04 10:54 | 3.4M | |
![[SND]](/icons/sound2.gif) | [drv3] a.a. - ch. 1 (new).opus | 2021-04-30 11:34 | 3.4M | |
![[SND]](/icons/sound2.gif) | [touhou] lunatic eyes ~ invisible full moon.opus | 2022-12-28 13:49 | 3.4M | |
![[SND]](/icons/sound2.gif) | [p5] beneath the mask.opus | 2021-05-02 21:16 | 3.4M | |
![[SND]](/icons/sound2.gif) | [dr2] homicide.opus | 2021-04-29 12:39 | 3.4M | |
![[SND]](/icons/sound2.gif) | [HDusk] Secrets ~ HD.opus | 2023-07-03 00:47 | 3.4M | |
![[SND]](/icons/sound2.gif) | [999] octal game.opus | 2021-05-02 14:13 | 3.4M | |
![[SND]](/icons/sound2.gif) | [umi] Mortal stampede.opus | 2024-04-08 05:29 | 3.4M | |
![[SND]](/icons/sound2.gif) | [umi] Rhythm-changer.opus | 2024-04-08 02:50 | 3.4M | |
![[SND]](/icons/sound2.gif) | [umi] Like the gale.opus | 2024-04-08 05:19 | 3.4M | |
![[SND]](/icons/sound2.gif) | [yttd] unpleasant wind.opus | 2021-05-04 10:54 | 3.4M | |
![[SND]](/icons/sound2.gif) | [drv3] class trial v3 - the sun.opus | 2021-04-30 11:36 | 3.4M | |
![[SND]](/icons/sound2.gif) | [p5r] no more what ifs -instrumental version-.opus | 2021-05-03 09:01 | 3.5M | |
![[SND]](/icons/sound2.gif) | [dr2] beautiful ruin.opus | 2021-04-29 12:40 | 3.5M | |
![[SND]](/icons/sound2.gif) | [yttd] reason it out a.opus | 2021-05-04 10:52 | 3.5M | |
![[SND]](/icons/sound2.gif) | [umi] The end of the world(vocals).opus | 2024-09-12 00:21 | 3.5M | |
![[SND]](/icons/sound2.gif) | [dr1] class trial - the sun.opus | 2021-04-29 08:40 | 3.5M | |
![[SND]](/icons/sound2.gif) | [p5r] another ideology.opus | 2021-05-03 09:01 | 3.5M | |
![[SND]](/icons/sound2.gif) | [ssbu] gangplank galleon.opus | 2023-10-01 10:55 | 3.5M | |
![[SND]](/icons/sound2.gif) | [yttd] rock.opus | 2021-05-04 10:52 | 3.5M | |
![[SND]](/icons/sound2.gif) | [umi] Solitary deep sea fish.opus | 2024-04-08 16:38 | 3.5M | |
![[SND]](/icons/sound2.gif) | [drv3] discussion v3 -heat up-.opus | 2021-04-30 11:35 | 3.5M | |
![[SND]](/icons/sound2.gif) | [yttd] seme-ks.opus | 2021-05-04 10:53 | 3.5M | |
![[SND]](/icons/sound2.gif) | [umi] ALIVE.opus | 2024-04-08 21:08 | 3.5M | |
![[SND]](/icons/sound2.gif) | [HDusk] Amber Sunset ~ HD.opus | 2023-07-03 00:56 | 3.5M | |
![[SND]](/icons/sound2.gif) | [yttd] zetu.opus | 2021-05-04 10:54 | 3.5M | |
![[SND]](/icons/sound2.gif) | [umi] Dancing pipe.opus | 2024-04-08 02:50 | 3.5M | |
![[SND]](/icons/sound2.gif) | [999] recollection.opus | 2021-05-02 14:13 | 3.5M | |
![[SND]](/icons/sound2.gif) | [yttd] smiling around.opus | 2021-05-04 10:53 | 3.5M | |
![[SND]](/icons/sound2.gif) | [Terraria] Calamity mod music - Catastrophes before the calamity.opus | 2024-09-20 07:27 | 3.5M | |
![[SND]](/icons/sound2.gif) | [p4a] chie satonaka - like the dragon.opus | 2021-05-02 21:02 | 3.5M | |
![[SND]](/icons/sound2.gif) | [yttd] samurai woman.opus | 2021-05-04 10:53 | 3.6M | |
![[SND]](/icons/sound2.gif) | [999] quinary game.opus | 2021-05-02 14:13 | 3.6M | |
![[SND]](/icons/sound2.gif) | [yttd] all move forward.opus | 2021-05-04 10:50 | 3.6M | |
![[SND]](/icons/sound2.gif) | [yttd] tengoku.opus | 2021-05-04 10:53 | 3.6M | |
![[SND]](/icons/sound2.gif) | [dr2] p.t.a. (instrumental mix).opus | 2021-04-30 18:20 | 3.6M | |
![[SND]](/icons/sound2.gif) | [yttd] not so, sou b.opus | 2021-05-04 10:52 | 3.6M | |
![[SND]](/icons/sound2.gif) | [umi] Where.opus | 2024-04-08 02:45 | 3.6M | |
![[SND]](/icons/sound2.gif) | [p4] electronica in velvet room.opus | 2021-05-02 19:51 | 3.6M | |
![[SND]](/icons/sound2.gif) | [ahit] you are now legally a bird.opus | 2021-05-01 17:19 | 3.6M | |
![[SND]](/icons/sound2.gif) | [yttd] seme.opus | 2021-05-04 10:53 | 3.6M | |
![[SND]](/icons/sound2.gif) | [umi] Scorpion entrails.opus | 2024-04-07 16:01 | 3.6M | |
![[SND]](/icons/sound2.gif) | [p5] beneath the mask -rain-.opus | 2021-05-02 21:16 | 3.6M | |
![[SND]](/icons/sound2.gif) | [Kirby] CROWNED.opus | 2024-09-21 00:49 | 3.6M | |
![[SND]](/icons/sound2.gif) | [p5] beneath the mask -instrumental version-.opus | 2021-05-02 21:16 | 3.6M | |
![[SND]](/icons/sound2.gif) | [ahit] welcome to mafia town.opus | 2021-05-01 17:18 | 3.6M | |
![[SND]](/icons/sound2.gif) | [yttd] not so, sou a.opus | 2021-05-04 10:52 | 3.6M | |
![[SND]](/icons/sound2.gif) | [umi] Fake red shoes.opus | 2024-04-08 02:32 | 3.6M | |
![[SND]](/icons/sound2.gif) | [yttd] tikurin.opus | 2021-05-04 10:53 | 3.6M | |
![[SND]](/icons/sound2.gif) | [999] septenary game.opus | 2021-05-02 14:13 | 3.7M | |
![[SND]](/icons/sound2.gif) | [yttd] don't be daunted a.opus | 2021-05-04 10:51 | 3.7M | |
![[SND]](/icons/sound2.gif) | [UMI] String Trio 600 Million in F Minor.opus | 2024-04-08 16:38 | 3.7M | |
![[SND]](/icons/sound2.gif) | [yttd] kikaion.opus | 2021-05-04 10:52 | 3.7M | |
![[SND]](/icons/sound2.gif) | [999] ternary game.opus | 2021-05-02 14:14 | 3.7M | |
![[SND]](/icons/sound2.gif) | [p4au] elizabeth - battle for everyone's souls.opus | 2021-05-02 21:02 | 3.7M | |
![[SND]](/icons/sound2.gif) | [999] eternitybox.opus | 2021-05-02 14:13 | 3.7M | |
![[SND]](/icons/sound2.gif) | [umi] Golden Nocturne.opus | 2024-04-08 21:24 | 3.7M | |
![[SND]](/icons/sound2.gif) | [umi] Deep blue jeer.opus | 2024-04-08 16:29 | 3.7M | |
![[SND]](/icons/sound2.gif) | [yttd] don't be daunted b.opus | 2021-05-04 10:51 | 3.7M | |
![[SND]](/icons/sound2.gif) | [p3] the battle for everyone's souls.opus | 2021-05-02 19:32 | 3.7M | |
![[SND]](/icons/sound2.gif) | [yttd] setuna.opus | 2021-05-04 10:53 | 3.7M | |
![[SND]](/icons/sound2.gif) | [yttd] boss.opus | 2021-05-04 10:50 | 3.7M | |
![[SND]](/icons/sound2.gif) | [yttd] your turn to go.opus | 2021-05-04 10:54 | 3.7M | |
![[SND]](/icons/sound2.gif) | [umi] lixAxil.opus | 2024-04-08 21:44 | 3.8M | |
![[SND]](/icons/sound2.gif) | [umi] Lost paradise.opus | 2024-04-08 05:03 | 3.8M | |
![[SND]](/icons/sound2.gif) | [dr1] box 16.opus | 2021-04-29 08:39 | 3.8M | |
![[SND]](/icons/sound2.gif) | [yttd] exploration b.opus | 2021-05-04 10:51 | 3.8M | |
![[SND]](/icons/sound2.gif) | [touhou] flight of the bamboo cutter ~ lunatic princess.opus | 2022-12-28 13:56 | 3.8M | |
![[SND]](/icons/sound2.gif) | [yttd] majority vote b - maou.opus | 2021-05-04 10:52 | 3.8M | |
![[SND]](/icons/sound2.gif) | [yttd] sin9 (cardiogram second peak).opus | 2021-05-04 10:53 | 3.8M | |
![[SND]](/icons/sound2.gif) | [umi] Cage.opus | 2024-04-07 15:52 | 3.8M | |
![[SND]](/icons/sound2.gif) | [yttd] majority vote a - majority rules.opus | 2021-05-04 10:52 | 3.8M | |
![[SND]](/icons/sound2.gif) | [yttd] hasire.opus | 2021-05-04 10:51 | 3.8M | |
![[SND]](/icons/sound2.gif) | [umi] Prison strip.opus | 2024-04-07 15:52 | 3.8M | |
![[SND]](/icons/sound2.gif) | [yttd] cardiogram peak.opus | 2021-05-04 10:50 | 3.8M | |
![[SND]](/icons/sound2.gif) | [yttd] zyoban.opus | 2021-05-04 10:54 | 3.8M | |
![[SND]](/icons/sound2.gif) | [umi] Parallel.opus | 2024-04-08 05:19 | 3.9M | |
![[SND]](/icons/sound2.gif) | [umi] Infant Queen Bee.opus | 2024-04-08 21:01 | 3.9M | |
![[SND]](/icons/sound2.gif) | [p5] beneath the mask -instrumental version, rain-.opus | 2021-05-02 21:16 | 3.9M | |
![[SND]](/icons/sound2.gif) | [yttd] sousa.opus | 2021-05-04 10:53 | 3.9M | |
![[SND]](/icons/sound2.gif) | [999] morphogenetic sorrow.opus | 2021-05-02 14:13 | 3.9M | |
![[SND]](/icons/sound2.gif) | [yttd] kaisou.opus | 2021-05-04 10:52 | 3.9M | |
![[SND]](/icons/sound2.gif) | [umi] Lie-alaiaa.opus | 2024-04-08 21:24 | 3.9M | |
![[SND]](/icons/sound2.gif) | [UT] Reality check through the skull.opus | 2024-09-19 08:58 | 3.9M | |
![[SND]](/icons/sound2.gif) | [p5] rivers in the desert.opus | 2021-05-02 21:18 | 3.9M | |
![[SND]](/icons/sound2.gif) | [umi] The girls witch hunt.opus | 2024-04-08 16:38 | 3.9M | |
![[SND]](/icons/sound2.gif) | [umi] Kina no Kaori.opus | 2024-04-08 21:01 | 3.9M | |
![[SND]](/icons/sound2.gif) | [999] 9 years.opus | 2021-05-02 14:13 | 3.9M | |
![[SND]](/icons/sound2.gif) | [yttd] into the incident.opus | 2021-05-04 10:51 | 3.9M | |
![[SND]](/icons/sound2.gif) | [umi] Ruriair.opus | 2024-04-08 21:09 | 3.9M | |
![[SND]](/icons/sound2.gif) | [dr1] beautiful death.opus | 2021-04-29 08:41 | 3.9M | |
![[SND]](/icons/sound2.gif) | [umi] Suspicion.opus | 2024-04-07 15:23 | 3.9M | |
![[SND]](/icons/sound2.gif) | [drv3] closing argument v3.opus | 2021-04-30 11:36 | 4.0M | |
![[SND]](/icons/sound2.gif) | [yttd] exploration a.opus | 2021-05-04 10:51 | 4.0M | |
![[SND]](/icons/sound2.gif) | [celeste] beyond the heart.opus | 2021-05-01 19:12 | 4.0M | |
![[SND]](/icons/sound2.gif) | [umi] Battlefield.opus | 2024-04-08 21:08 | 4.0M | |
![[SND]](/icons/sound2.gif) | [umi] Totem blume.opus | 2024-04-08 16:38 | 4.1M | |
![[SND]](/icons/sound2.gif) | [p5] rivers in the desert -instrumental version-.opus | 2021-05-02 21:18 | 4.1M | |
![[SND]](/icons/sound2.gif) | [yttd] gate of hell.opus | 2021-05-04 10:51 | 4.1M | |
![[SND]](/icons/sound2.gif) | [umi] Apathy.opus | 2024-04-08 05:19 | 4.1M | |
![[SND]](/icons/sound2.gif) | [yttd] cardiogram prelude.opus | 2021-05-04 10:50 | 4.1M | |
![[SND]](/icons/sound2.gif) | [umi] Bring the fate.opus | 2024-04-08 02:45 | 4.1M | |
![[SND]](/icons/sound2.gif) | [umi] Steady pace.opus | 2024-04-07 15:05 | 4.1M | |
![[SND]](/icons/sound2.gif) | [umi] Yomitsu Hirasaka Corruption.opus | 2024-04-08 21:32 | 4.1M | |
![[SND]](/icons/sound2.gif) | [yttd] hakanai.opus | 2021-05-04 10:51 | 4.1M | |
![[SND]](/icons/sound2.gif) | [drv3] class trial v3 - dawn (vol. 3).opus | 2021-04-30 11:35 | 4.1M | |
![[SND]](/icons/sound2.gif) | [yttd] ithukusimu.opus | 2021-05-04 10:51 | 4.1M | |
![[SND]](/icons/sound2.gif) | [umi] Terminal entrance.opus | 2024-04-08 21:32 | 4.2M | |
![[SND]](/icons/sound2.gif) | [yttd] even in tragedy.opus | 2021-05-04 10:51 | 4.2M | |
![[SND]](/icons/sound2.gif) | [p3] memories of you.opus | 2021-05-02 19:32 | 4.2M | |
![[SND]](/icons/sound2.gif) | [umi] Wingless.opus | 2024-04-08 05:03 | 4.2M | |
![[SND]](/icons/sound2.gif) | [dr2] class trial - dawn (vol. 2).opus | 2021-04-29 12:39 | 4.2M | |
![[SND]](/icons/sound2.gif) | [Kirby] VS Star dream.opus | 2024-09-21 00:49 | 4.2M | |
![[SND]](/icons/sound2.gif) | [ahit] the end.opus | 2021-05-01 17:18 | 4.3M | |
![[SND]](/icons/sound2.gif) | [p3fes] brand new days.opus | 2021-05-02 19:41 | 4.3M | |
![[SND]](/icons/sound2.gif) | [umi] l&d circulation.opus | 2024-04-08 21:16 | 4.3M | |
![[SND]](/icons/sound2.gif) | [hk] sealed vessel.opus | 2021-05-02 10:21 | 4.3M | |
![[SND]](/icons/sound2.gif) | [umi] Anti-Demon Sequentia.opus | 2024-04-08 21:09 | 4.3M | |
![[SND]](/icons/sound2.gif) | [yttd] exploration c - tsurugi.opus | 2021-05-04 10:51 | 4.3M | |
![[SND]](/icons/sound2.gif) | [umi] Voiceless.opus | 2024-04-08 02:45 | 4.3M | |
![[SND]](/icons/sound2.gif) | [p4] aria of the soul.opus | 2021-05-02 19:52 | 4.3M | |
![[SND]](/icons/sound2.gif) | [p5] the poem of everyone's souls.opus | 2021-05-02 21:19 | 4.3M | |
![[SND]](/icons/sound2.gif) | [ahit] main theme.opus | 2021-05-01 17:18 | 4.3M | |
![[SND]](/icons/sound2.gif) | [umi] Victima propiciatoria.opus | 2024-04-08 05:29 | 4.4M | |
![[SND]](/icons/sound2.gif) | [p5r] ideal and the real.opus | 2021-05-03 09:01 | 4.4M | |
![[SND]](/icons/sound2.gif) | [umi] Sukashiyuri.opus | 2024-04-07 15:05 | 4.4M | |
![[SND]](/icons/sound2.gif) | [yttd] clown's song.opus | 2021-05-04 10:50 | 4.4M | |
![[SND]](/icons/sound2.gif) | [drv3] class trial v3 - space.opus | 2021-04-30 11:35 | 4.4M | |
![[SND]](/icons/sound2.gif) | [celeste] reflection.opus | 2021-05-01 19:13 | 4.4M | |
![[SND]](/icons/sound2.gif) | [umi] Kuina.opus | 2024-04-08 16:38 | 4.5M | |
![[SND]](/icons/sound2.gif) | [umi] The End of the World.opus | 2024-04-08 21:32 | 4.5M | |
![[SND]](/icons/sound2.gif) | [umi] Sakura.opus | 2024-04-08 02:45 | 4.5M | |
![[SND]](/icons/sound2.gif) | [yttd] exploration d - tansaku.opus | 2021-05-04 10:51 | 4.5M | |
![[SND]](/icons/sound2.gif) | [umi] Fortitude.opus | 2024-04-07 15:05 | 4.5M | |
![[SND]](/icons/sound2.gif) | [drv3] trial - end.opus | 2021-04-30 11:39 | 4.5M | |
![[SND]](/icons/sound2.gif) | [Kirby] Sullied grace.opus | 2024-09-21 00:50 | 4.5M | |
![[SND]](/icons/sound2.gif) | [umi] The Sin.opus | 2024-04-08 21:09 | 4.5M | |
![[SND]](/icons/sound2.gif) | [yttd] tinkonka.opus | 2021-05-04 10:53 | 4.6M | |
![[SND]](/icons/sound2.gif) | [yttd] sinzizitu.opus | 2021-05-04 10:53 | 4.6M | |
![[SND]](/icons/sound2.gif) | [celeste] fear of the unknown.opus | 2021-05-01 19:12 | 4.6M | |
![[SND]](/icons/sound2.gif) | [yttd] kakure1.opus | 2021-05-04 10:52 | 4.6M | |
![[SND]](/icons/sound2.gif) | [umi] Proud dust.opus | 2024-04-08 16:38 | 4.7M | |
![[SND]](/icons/sound2.gif) | [umi] Birth of new witch (instrumental).opus | 2024-04-08 21:09 | 4.7M | |
![[SND]](/icons/sound2.gif) | [umi] Revelations.opus | 2024-04-08 21:44 | 4.7M | |
![[SND]](/icons/sound2.gif) | [celeste] scattered and lost.opus | 2021-05-01 19:13 | 4.7M | |
![[SND]](/icons/sound2.gif) | [umi] revelations (instrumental).opus | 2024-09-23 02:33 | 4.7M | |
![[SND]](/icons/sound2.gif) | [yttd] kind moment.opus | 2021-05-04 10:52 | 4.8M | |
![[SND]](/icons/sound2.gif) | [umi] Endless nine.opus | 2024-04-08 05:29 | 4.8M | |
![[SND]](/icons/sound2.gif) | [umi] Reflection call.opus | 2024-04-08 21:16 | 4.8M | |
![[SND]](/icons/sound2.gif) | [ut] another medium (jazz cover).opus | 2021-05-07 17:14 | 4.8M | |
![[SND]](/icons/sound2.gif) | [p4] never more.opus | 2021-05-02 19:52 | 4.8M | |
![[SND]](/icons/sound2.gif) | [umi] Fall.opus | 2024-04-08 21:24 | 4.8M | |
![[SND]](/icons/sound2.gif) | [dr2] kill command.opus | 2021-04-29 12:41 | 4.9M | |
![[SND]](/icons/sound2.gif) | [UMI] Busy Devils.opus | 2024-09-29 14:28 | 4.9M | |
![[SND]](/icons/sound2.gif) | [umi] Ballade continuer.opus | 2024-04-08 21:24 | 5.0M | |
![[SND]](/icons/sound2.gif) | [umi] Haze.opus | 2024-04-08 02:50 | 5.0M | |
![[SND]](/icons/sound2.gif) | [umi] Rain.opus | 2024-04-08 21:24 | 5.0M | |
![[SND]](/icons/sound2.gif) | [umi] Black Lilliana.opus | 2024-04-08 02:45 | 5.0M | |
![[SND]](/icons/sound2.gif) | [p3] one determination.opus | 2021-05-06 11:07 | 5.0M | |
![[SND]](/icons/sound2.gif) | [p5] with the stars and us.opus | 2021-05-02 21:19 | 5.1M | |
![[SND]](/icons/sound2.gif) | [umi] Dive to emergency.opus | 2024-04-08 05:29 | 5.1M | |
![[SND]](/icons/sound2.gif) | [yttd] day of tragedy.opus | 2021-05-04 10:50 | 5.1M | |
![[SND]](/icons/sound2.gif) | [ut] undertale.opus | 2021-05-03 12:47 | 5.2M | |
![[SND]](/icons/sound2.gif) | [umi] Song without a name (ver. 2007).opus | 2024-04-08 21:24 | 5.2M | |
![[SND]](/icons/sound2.gif) | [umi] Justice.opus | 2024-04-08 16:38 | 5.3M | |
![[SND]](/icons/sound2.gif) | [p5r] our light.opus | 2021-05-03 09:02 | 5.3M | |
![[SND]](/icons/sound2.gif) | [umi] S he end.opus | 2024-04-08 21:32 | 5.3M | |
![[SND]](/icons/sound2.gif) | [umi] Novelette.opus | 2024-04-07 14:58 | 5.3M | |
![[SND]](/icons/sound2.gif) | [pkmn5] driftveil city.opus | 2021-05-03 06:25 | 5.3M | |
![[SND]](/icons/sound2.gif) | [dr1] class trial - dawn.opus | 2021-04-29 08:40 | 5.3M | |
![[SND]](/icons/sound2.gif) | [yttd] gekituu.opus | 2021-05-04 10:51 | 5.3M | |
![[SND]](/icons/sound2.gif) | [umi] Worldend.opus | 2024-04-07 15:38 | 5.3M | |
![[SND]](/icons/sound2.gif) | [fe3h] god-shattering star (rain).opus | 2021-05-01 19:49 | 5.4M | |
![[SND]](/icons/sound2.gif) | [Miitopia] The darkest lord.opus | 2024-09-19 08:58 | 5.4M | |
![[SND]](/icons/sound2.gif) | [celeste] quiet and falling.opus | 2021-05-01 19:13 | 5.4M | |
![[SND]](/icons/sound2.gif) | [umi] Discolor.opus | 2024-04-08 20:53 | 5.4M | |
![[SND]](/icons/sound2.gif) | [umi] Dread of the grave.opus | 2024-04-08 02:19 | 5.4M | |
![[SND]](/icons/sound2.gif) | [umi] My dear.opus | 2024-04-08 21:01 | 5.5M | |
![[SND]](/icons/sound2.gif) | [yttd] nao2.opus | 2021-05-04 10:52 | 5.5M | |
![[SND]](/icons/sound2.gif) | [umi] Golden sneer.opus | 2024-04-07 15:52 | 5.5M | |
![[SND]](/icons/sound2.gif) | [umi] Bizarre Divertimento.opus | 2024-04-08 21:44 | 5.5M | |
![[SND]](/icons/sound2.gif) | [umi] Dread of the grave -More fear-.opus | 2024-04-08 02:50 | 5.5M | |
![[SND]](/icons/sound2.gif) | [p4] the genesis.opus | 2021-05-02 19:52 | 5.5M | |
![[SND]](/icons/sound2.gif) | [umi] en-counse.opus | 2024-04-08 21:44 | 5.7M | |
![[SND]](/icons/sound2.gif) | [umi] Dread of the Grave -More Fear- (remake).opus | 2024-04-08 21:44 | 5.7M | |
![[SND]](/icons/sound2.gif) | [umi] Patchwork chimera.opus | 2024-04-08 16:38 | 5.7M | |
![[SND]](/icons/sound2.gif) | [umi] Goddess gardena.opus | 2024-04-08 21:32 | 5.8M | |
![[SND]](/icons/sound2.gif) | [umi] Golden slaughterer.opus | 2024-04-07 15:23 | 5.8M | |
![[SND]](/icons/sound2.gif) | [Kirby] Two planets approach the roche limit.opus | 2024-09-21 00:50 | 5.9M | |
![[SND]](/icons/sound2.gif) | [umi] Dead angle.opus | 2024-04-08 02:45 | 6.0M | |
![[SND]](/icons/sound2.gif) | [celeste] farewell.opus | 2021-05-01 19:12 | 6.1M | |
![[SND]](/icons/sound2.gif) | [drv3] hope searching.opus | 2021-04-30 11:37 | 6.1M | |
![[SND]](/icons/sound2.gif) | [umi] Miragecoordinator.opus | 2024-04-08 05:03 | 6.1M | |
![[SND]](/icons/sound2.gif) | [terraria] calamity mod music - roar of the jungle dragon.opus | 2021-05-03 18:52 | 6.1M | |
![[SND]](/icons/sound2.gif) | [umi] The Executioner.opus | 2024-04-08 21:32 | 6.2M | |
![[SND]](/icons/sound2.gif) | [beethoven] moonlight sonata - 3rd movement.opus | 2021-05-06 08:34 | 6.2M | |
![[SND]](/icons/sound2.gif) | [umi] Bore ral.opus | 2024-04-08 21:24 | 6.3M | |
![[SND]](/icons/sound2.gif) | [umi] Song without a name(instrumental).opus | 2024-04-08 21:32 | 6.3M | |
![[SND]](/icons/sound2.gif) | [fe3h] the apex of the world (rain).opus | 2021-05-01 19:49 | 6.3M | |
![[SND]](/icons/sound2.gif) | [umi] liberatedliberator.opus | 2024-09-23 02:32 | 6.3M | |
![[SND]](/icons/sound2.gif) | [Terraria] Calamity mod music - Raw unfiltered calamity.opus | 2024-09-20 07:25 | 6.5M | |
![[SND]](/icons/sound2.gif) | [umi] Worldenddominator.opus | 2024-09-23 02:39 | 6.5M | |
![[SND]](/icons/sound2.gif) | [ahit] you are all bad guys.opus | 2021-05-01 17:18 | 6.6M | |
![[SND]](/icons/sound2.gif) | [p3] tartarus (blocks 1-6).opus | 2021-05-02 19:32 | 6.8M | |
![[SND]](/icons/sound2.gif) | [celeste] in the mirror.opus | 2021-05-01 19:12 | 6.8M | |
![[SND]](/icons/sound2.gif) | [umi] 7 weights.opus | 2024-04-08 21:24 | 6.9M | |
![[SND]](/icons/sound2.gif) | [umi] Death (from stupefaction).opus | 2024-04-08 05:29 | 6.9M | |
![[SND]](/icons/sound2.gif) | [umi] Resurrectedreplayer.opus | 2024-09-23 02:31 | 7.2M | |
![[SND]](/icons/sound2.gif) | [celeste] summit (no more running mix).opus | 2021-05-01 19:13 | 7.3M | |
![[SND]](/icons/sound2.gif) | [celeste] resurrections.opus | 2021-05-01 19:13 | 7.4M | |
![[SND]](/icons/sound2.gif) | [umi] Rose.opus | 2024-04-07 14:58 | 7.8M | |
![[SND]](/icons/sound2.gif) | [umi] Melody (instrumental).opus | 2024-04-08 02:19 | 7.9M | |
![[SND]](/icons/sound2.gif) | [umi] Psy-chorus.opus | 2024-04-08 02:32 | 8.0M | |
![[SND]](/icons/sound2.gif) | [umi] Dreamenddischarger.opus | 2024-04-08 05:29 | 8.0M | |
![[SND]](/icons/sound2.gif) | [celeste] reach for the summit.opus | 2021-05-01 19:13 | 8.1M | |
![[SND]](/icons/sound2.gif) | [umi] Le 4 Octobre.opus | 2024-04-08 21:16 | 8.2M | |
![[SND]](/icons/sound2.gif) | [dr] heroes in spades.opus | 2021-05-07 17:13 | 8.4M | |
![[SND]](/icons/sound2.gif) | [Terraria] Calamity mod music - Stained brutal calamity.opus | 2024-09-19 08:56 | 8.5M | |
![[SND]](/icons/sound2.gif) | [umi] lastendconductor.opus | 2024-04-08 21:44 | 8.9M | |
|